8-[(3S)-4-hydroxy-3-methylbutoxy]-7-methoxychromen-2-one
| Internal ID | 0ecb056f-3f0e-43ef-9dbd-cee8496d3d2b |
| Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives |
| IUPAC Name | 8-[(3S)-4-hydroxy-3-methylbutoxy]-7-methoxychromen-2-one |
| SMILES (Canonical) | CC(CCOC1=C(C=CC2=C1OC(=O)C=C2)OC)CO |
| SMILES (Isomeric) | C[C@@H](CCOC1=C(C=CC2=C1OC(=O)C=C2)OC)CO |
| InChI | InChI=1S/C15H18O5/c1-10(9-16)7-8-19-15-12(18-2)5-3-11-4-6-13(17)20-14(11)15/h3-6,10,16H,7-9H2,1-2H3/t10-/m0/s1 |
| InChI Key | JIDBOVMHSLMAAN-JTQLQIEISA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.11542367 g/mol |
| Topological Polar Surface Area (TPSA) | 65.00 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.15% | 83.82% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.14% | 94.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.23% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.62% | 99.17% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 89.47% | 90.20% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.15% | 94.45% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.61% | 96.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.60% | 96.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.40% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.09% | 95.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.47% | 98.75% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.71% | 90.71% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.66% | 94.75% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.52% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Artemisia armeniaca |
| Artemisia tanacetifolia |
| Skimmia laureola |
| PubChem | 163031881 |
| LOTUS | LTS0105054 |
| wikiData | Q105128933 |