8-(2,3,4,5-tetrahydroxypentyl)-1H-pteridine-2,4,7-trione
| Internal ID | 81ce48af-d34f-43f8-b6d0-768431c07705 |
| Taxonomy | Organoheterocyclic compounds > Pteridines and derivatives |
| IUPAC Name | 8-(2,3,4,5-tetrahydroxypentyl)-1H-pteridine-2,4,7-trione |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C11H14N4O7/c16-3-5(18)8(20)4(17)2-15-6(19)1-12-7-9(15)13-11(22)14-10(7)21/h1,4-5,8,16-18,20H,2-3H2,(H2,13,14,21,22) |
| InChI Key | IZHUKSHKRISQGL-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C11H14N4O7 |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 314.08624880 g/mol |
| Topological Polar Surface Area (TPSA) | 172.00 Ų |
| XlogP | -4.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.40% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 92.41% | 83.82% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.95% | 94.45% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.80% | 85.14% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 89.66% | 86.92% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.01% | 94.75% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.26% | 98.75% |
| CHEMBL2424504 | P29375 | Lysine-specific demethylase 5A | 86.16% | 99.23% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 85.86% | 98.59% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 85.82% | 93.10% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.62% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.46% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.16% | 99.23% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.05% | 90.08% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.79% | 90.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.21% | 99.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.43% | 94.73% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 80.26% | 97.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163037727 |
| LOTUS | LTS0122886 |
| wikiData | Q105123218 |