[(7S,8R)-7-hydroxy-5,6,7,8-tetrahydro-3H-pyrrolizin-1-yl]methyl (2S)-2-hydroxy-2,3-dimethylbutanoate
Internal ID | cfab1497-a696-41ca-ae34-6b8d4fe301f2 |
Taxonomy | Alkaloids and derivatives |
IUPAC Name | [(7S,8R)-7-hydroxy-5,6,7,8-tetrahydro-3H-pyrrolizin-1-yl]methyl (2S)-2-hydroxy-2,3-dimethylbutanoate |
SMILES (Canonical) | CC(C)C(C)(C(=O)OCC1=CCN2C1C(CC2)O)O |
SMILES (Isomeric) | CC(C)[C@@](C)(C(=O)OCC1=CCN2[C@H]1[C@H](CC2)O)O |
InChI | InChI=1S/C14H23NO4/c1-9(2)14(3,18)13(17)19-8-10-4-6-15-7-5-11(16)12(10)15/h4,9,11-12,16,18H,5-8H2,1-3H3/t11-,12+,14-/m0/s1 |
InChI Key | TZHAMNIFJHFPNN-SCRDCRAPSA-N |
Popularity | 0 references in papers |
Molecular Formula | C14H23NO4 |
Molecular Weight | 269.34 g/mol |
Exact Mass | 269.16270821 g/mol |
Topological Polar Surface Area (TPSA) | 70.00 Ų |
XlogP | 0.20 |
There are no found synonyms. |
![2D Structure of [(7S,8R)-7-hydroxy-5,6,7,8-tetrahydro-3H-pyrrolizin-1-yl]methyl (2S)-2-hydroxy-2,3-dimethylbutanoate 2D Structure of [(7S,8R)-7-hydroxy-5,6,7,8-tetrahydro-3H-pyrrolizin-1-yl]methyl (2S)-2-hydroxy-2,3-dimethylbutanoate](https://plantaedb.com/storage/docs/compounds/2023/11/7s8r-7-hydroxy-5678-tetrahydro-3h-pyrrolizin-1-ylmethyl-2s-2-hydroxy-23-dimethylbutanoate.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.90% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 97.05% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.58% | 97.25% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.74% | 95.89% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.73% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.36% | 85.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.44% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.24% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.16% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.73% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.11% | 95.89% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.98% | 100.00% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.47% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ageratum houstonianum |
PubChem | 12972112 |
LOTUS | LTS0010864 |
wikiData | Q105268148 |