(7R)-4-methoxy-7-methyl-7,8-dihydrofuro[2,3-g]isochromen-5-one
Internal ID | 2e9902ea-cd98-44b8-948b-9acabe8a21c8 |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 2-benzopyrans |
IUPAC Name | (7R)-4-methoxy-7-methyl-7,8-dihydrofuro[2,3-g]isochromen-5-one |
SMILES (Canonical) | CC1CC2=CC3=C(C=CO3)C(=C2C(=O)O1)OC |
SMILES (Isomeric) | C[C@@H]1CC2=CC3=C(C=CO3)C(=C2C(=O)O1)OC |
InChI | InChI=1S/C13H12O4/c1-7-5-8-6-10-9(3-4-16-10)12(15-2)11(8)13(14)17-7/h3-4,6-7H,5H2,1-2H3/t7-/m1/s1 |
InChI Key | LJCCQQNTPLPSNX-SSDOTTSWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C13H12O4 |
Molecular Weight | 232.23 g/mol |
Exact Mass | 232.07355886 g/mol |
Topological Polar Surface Area (TPSA) | 48.70 Ų |
XlogP | 2.60 |
There are no found synonyms. |
![2D Structure of (7R)-4-methoxy-7-methyl-7,8-dihydrofuro[2,3-g]isochromen-5-one 2D Structure of (7R)-4-methoxy-7-methyl-7,8-dihydrofuro[2,3-g]isochromen-5-one](https://plantaedb.com/storage/docs/compounds/2023/11/7r-4-methoxy-7-methyl-78-dihydrofuro23-gisochromen-5-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.04% | 91.49% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.46% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.65% | 95.56% |
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 93.98% | 94.03% |
CHEMBL2581 | P07339 | Cathepsin D | 92.06% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.47% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.36% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.71% | 85.14% |
CHEMBL2535 | P11166 | Glucose transporter | 85.22% | 98.75% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 84.81% | 96.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.67% | 94.00% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 84.26% | 91.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.26% | 99.23% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 81.16% | 97.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.83% | 99.17% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.06% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Coriandrum sativum |
PubChem | 162868569 |
LOTUS | LTS0137062 |
wikiData | Q105152479 |