[(7R)-3,3,7,9-tetramethyl-11-oxo-4-tricyclo[5.4.0.02,8]undec-9-enyl] acetate
Internal ID | 0f767093-1ca6-4a06-9e52-9343015f6c3d |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Bicyclic monoterpenoids |
IUPAC Name | [(7R)-3,3,7,9-tetramethyl-11-oxo-4-tricyclo[5.4.0.02,8]undec-9-enyl] acetate |
SMILES (Canonical) | CC1=CC(=O)C2C3C1C2(CCC(C3(C)C)OC(=O)C)C |
SMILES (Isomeric) | CC1=CC(=O)C2C3C1[C@]2(CCC(C3(C)C)OC(=O)C)C |
InChI | InChI=1S/C17H24O3/c1-9-8-11(19)14-15-13(9)17(14,5)7-6-12(16(15,3)4)20-10(2)18/h8,12-15H,6-7H2,1-5H3/t12?,13?,14?,15?,17-/m1/s1 |
InChI Key | JSEBWGTWIOLTFP-UGQLREHASA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H24O3 |
Molecular Weight | 276.40 g/mol |
Exact Mass | 276.17254462 g/mol |
Topological Polar Surface Area (TPSA) | 43.40 Ų |
XlogP | 2.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.30% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.81% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 89.91% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.98% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.44% | 95.56% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 87.87% | 93.04% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.31% | 100.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.01% | 82.69% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.14% | 89.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.92% | 99.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.25% | 95.89% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.99% | 94.75% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.96% | 91.19% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.69% | 97.09% |
CHEMBL5028 | O14672 | ADAM10 | 80.33% | 97.50% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.30% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artemisia argyi |
PubChem | 5319905 |
LOTUS | LTS0138665 |
wikiData | Q105134294 |