[4a,5-Dimethyl-2-(2-methylbutanoyloxy)-7-oxo-3-prop-1-en-2-yl-1,2,3,4,5,6,8,8a-octahydronaphthalen-1-yl] 2-methylbutanoate
| Internal ID | 8562a8e4-24a9-4ff6-b5ff-41e6eb745668 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Eremophilane, 8,9-secoeremophilane and furoeremophilane sesquiterpenoids |
| IUPAC Name | [4a,5-dimethyl-2-(2-methylbutanoyloxy)-7-oxo-3-prop-1-en-2-yl-1,2,3,4,5,6,8,8a-octahydronaphthalen-1-yl] 2-methylbutanoate |
| SMILES (Canonical) | CCC(C)C(=O)OC1C2CC(=O)CC(C2(CC(C1OC(=O)C(C)CC)C(=C)C)C)C |
| SMILES (Isomeric) | CCC(C)C(=O)OC1C2CC(=O)CC(C2(CC(C1OC(=O)C(C)CC)C(=C)C)C)C |
| InChI | InChI=1S/C25H40O5/c1-9-15(5)23(27)29-21-19(14(3)4)13-25(8)17(7)11-18(26)12-20(25)22(21)30-24(28)16(6)10-2/h15-17,19-22H,3,9-13H2,1-2,4-8H3 |
| InChI Key | DTILZURXFHKQKD-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.28757437 g/mol |
| Topological Polar Surface Area (TPSA) | 69.70 Ų |
| XlogP | 5.70 |
| There are no found synonyms. |
![2D Structure of [4a,5-Dimethyl-2-(2-methylbutanoyloxy)-7-oxo-3-prop-1-en-2-yl-1,2,3,4,5,6,8,8a-octahydronaphthalen-1-yl] 2-methylbutanoate](https://plantaedb.com/storage/docs/compounds/2023/11/7fb199b0-8588-11ee-9c94-77a6cdb86bb8.jpg "2D Structure of [4a,5-Dimethyl-2-(2-methylbutanoyloxy)-7-oxo-3-prop-1-en-2-yl-1,2,3,4,5,6,8,8a-octahydronaphthalen-1-yl] 2-methylbutanoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.92% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.78% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.99% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.99% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.84% | 98.95% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 90.69% | 98.03% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 89.84% | 97.79% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.89% | 96.77% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.05% | 97.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.47% | 91.19% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.97% | 95.56% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 83.78% | 96.61% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 81.61% | 89.50% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 80.25% | 82.69% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Euryops algoensis |
| PubChem | 14890392 |
| LOTUS | LTS0075992 |
| wikiData | Q104988812 |