[(7R,8R,9S,10R,12S,13R,14S,17R)-17-[(1S)-1-[(1S,3R,5R)-1-ethyl-5,6,6-trimethyl-2,7,8-trioxabicyclo[3.2.1]octan-3-yl]ethyl]-7-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-12-yl] acetate
Internal ID | 012d0fd8-c3ec-4b99-99d4-12ad70d628c7 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Pregnane steroids > Gluco/mineralocorticoids, progestogins and derivatives |
IUPAC Name | [(7R,8R,9S,10R,12S,13R,14S,17R)-17-[(1S)-1-[(1S,3R,5R)-1-ethyl-5,6,6-trimethyl-2,7,8-trioxabicyclo[3.2.1]octan-3-yl]ethyl]-7-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-12-yl] acetate |
SMILES (Canonical) | CCC12OC(CC(O1)(C(O2)(C)C)C)C(C)C3CCC4C3(C(CC5C4C(CC6=CC(=O)C=CC56C)O)OC(=O)C)C |
SMILES (Isomeric) | CC[C@@]12O[C@H](C[C@@](O1)(C(O2)(C)C)C)[C@@H](C)[C@H]3CC[C@@H]4[C@@]3([C@H](C[C@H]5[C@H]4[C@@H](CC6=CC(=O)C=C[C@]56C)O)OC(=O)C)C |
InChI | InChI=1S/C33H48O7/c1-9-33-38-26(17-31(7,40-33)29(4,5)39-33)18(2)22-10-11-23-28-24(16-27(32(22,23)8)37-19(3)34)30(6)13-12-21(35)14-20(30)15-25(28)36/h12-14,18,22-28,36H,9-11,15-17H2,1-8H3/t18-,22+,23-,24-,25+,26+,27-,28-,30-,31+,32+,33-/m0/s1 |
InChI Key | IULOCGVGKDXJLF-QPOKWZOKSA-N |
Popularity | 0 references in papers |
Molecular Formula | C33H48O7 |
Molecular Weight | 556.70 g/mol |
Exact Mass | 556.34000387 g/mol |
Topological Polar Surface Area (TPSA) | 91.30 Ų |
XlogP | 5.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.17% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.93% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.17% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 95.51% | 95.93% |
CHEMBL2581 | P07339 | Cathepsin D | 94.87% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.79% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.81% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.61% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.29% | 91.19% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.48% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.11% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.14% | 94.45% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 87.74% | 97.79% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.19% | 97.25% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.34% | 92.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.96% | 95.56% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 84.19% | 95.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.99% | 99.17% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.62% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.94% | 99.23% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 81.64% | 97.28% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.34% | 97.14% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.76% | 93.04% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Petunia integrifolia |
PubChem | 162875298 |
LOTUS | LTS0066436 |
wikiData | Q105120694 |