(10R,11R)-10-[(10R,11S)-11-[(S)-[(2R,3S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-6-yl]-hydroxymethyl]-3,4,5,16,17,18-hexahydroxy-8,13-dioxo-9,12-dioxatricyclo[12.4.0.02,7]octadeca-1(18),2,4,6,14,16-hexaen-10-yl]-3,4,5,11,17,18,19-heptahydroxy-9,13-dioxatricyclo[13.4.0.02,7]nonadeca-1(19),2,4,6,15,17-hexaene-8,14-dione
Internal ID | 4ddb6c4e-23f1-445c-b7cb-3ee5956d97a9 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Complex tannins |
IUPAC Name | (10R,11R)-10-[(10R,11S)-11-[(S)-[(2R,3S)-2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxy-3,4-dihydro-2H-chromen-6-yl]-hydroxymethyl]-3,4,5,16,17,18-hexahydroxy-8,13-dioxo-9,12-dioxatricyclo[12.4.0.02,7]octadeca-1(18),2,4,6,14,16-hexaen-10-yl]-3,4,5,11,17,18,19-heptahydroxy-9,13-dioxatricyclo[13.4.0.02,7]nonadeca-1(19),2,4,6,15,17-hexaene-8,14-dione |
SMILES (Canonical) | C1C(C(OC2=C1C(=C(C(=C2)O)C(C3C(OC(=O)C4=CC(=C(C(=C4C5=C(C(=C(C=C5C(=O)O3)O)O)O)O)O)O)C6C(COC(=O)C7=CC(=C(C(=C7C8=C(C(=C(C=C8C(=O)O6)O)O)O)O)O)O)O)O)O)C9=CC(=C(C=C9)O)O)O |
SMILES (Isomeric) | C1[C@@H]([C@H](OC2=C1C(=C(C(=C2)O)[C@@H]([C@H]3[C@@H](OC(=O)C4=CC(=C(C(=C4C5=C(C(=C(C=C5C(=O)O3)O)O)O)O)O)O)[C@H]6[C@@H](COC(=O)C7=CC(=C(C(=C7C8=C(C(=C(C=C8C(=O)O6)O)O)O)O)O)O)O)O)O)C9=CC(=C(C=C9)O)O)O |
InChI | InChI=1S/C49H38O28/c50-17-2-1-11(3-18(17)51)42-24(57)4-12-26(74-42)9-19(52)31(32(12)59)41(68)44-45(77-49(72)16-8-23(56)36(63)40(67)30(16)29-15(48(71)76-44)7-22(55)35(62)39(29)66)43-25(58)10-73-46(69)13-5-20(53)33(60)37(64)27(13)28-14(47(70)75-43)6-21(54)34(61)38(28)65/h1-3,5-9,24-25,41-45,50-68H,4,10H2/t24-,25+,41-,42+,43+,44-,45-/m0/s1 |
InChI Key | CAHWVGJOCMGFBC-BOSOECPQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C49H38O28 |
Molecular Weight | 1074.80 g/mol |
Exact Mass | 1074.15496055 g/mol |
Topological Polar Surface Area (TPSA) | 499.00 Ų |
XlogP | 2.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.83% | 91.49% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.80% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.08% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.64% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.60% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.62% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.70% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.18% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.67% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.27% | 96.09% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 90.17% | 96.37% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.73% | 94.73% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.46% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.92% | 86.33% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.79% | 90.71% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 86.77% | 93.40% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.33% | 90.00% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 83.61% | 96.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.82% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.37% | 100.00% |
CHEMBL2535 | P11166 | Glucose transporter | 80.34% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Juglans regia |
PubChem | 16157131 |
LOTUS | LTS0123057 |
wikiData | Q104951378 |