(2S,3S,4S,5S,6S)-2-[(2S,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(1S,2S,4R,5'R,6S,7R,8S,9R,12R,13R,16S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl]oxy-5-[(2R,3S,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-4-[(2R,3S,4R,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | fcc1ab92-874d-4e22-b115-874701dded1a |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (2S,3S,4S,5S,6S)-2-[(2S,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(1S,2S,4R,5'R,6S,7R,8S,9R,12R,13R,16S)-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl]oxy-5-[(2R,3S,4R,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxy-4-[(2R,3S,4R,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC=C6C5(CCC(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)C)O)O)O)OC9C(C(C(CO9)O)O)O)OC2C(C(C(C(O2)C)O)O)O)C)C)C)NC1 |
SMILES (Isomeric) | C[C@@H]1CC[C@]2([C@@H]([C@@H]3[C@H](O2)C[C@@H]4[C@]3(CC[C@@H]5[C@H]4CC=C6[C@@]5(CC[C@@H](C6)O[C@@H]7[C@@H]([C@H]([C@@H]([C@@H](O7)CO)O[C@H]8[C@H]([C@H]([C@@H]([C@@H](O8)C)O)O)O)O[C@@H]9[C@H]([C@@H]([C@@H](CO9)O)O)O)O[C@@H]2[C@H]([C@@H]([C@H]([C@H](O2)C)O)O)O)C)C)C)NC1 |
InChI | InChI=1S/C50H81NO19/c1-20-9-14-50(51-17-20)21(2)32-30(70-50)16-28-26-8-7-24-15-25(10-12-48(24,5)27(26)11-13-49(28,32)6)65-47-43(69-46-40(61)37(58)34(55)23(4)64-46)42(68-44-38(59)35(56)29(53)19-62-44)41(31(18-52)66-47)67-45-39(60)36(57)33(54)22(3)63-45/h7,20-23,25-47,51-61H,8-19H2,1-6H3/t20-,21-,22+,23-,25+,26-,27-,28+,29-,30-,31+,32-,33-,34+,35-,36+,37-,38+,39+,40+,41-,42+,43-,44-,45+,46-,47+,48+,49-,50+/m1/s1 |
InChI Key | CUGWSRFIUQZYLJ-KBKBMEKMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C50H81NO19 |
Molecular Weight | 1000.20 g/mol |
Exact Mass | 999.54027935 g/mol |
Topological Polar Surface Area (TPSA) | 297.00 Ų |
XlogP | -0.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.13% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.78% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 97.83% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.83% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.35% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.30% | 94.45% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.58% | 100.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.48% | 94.00% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 89.28% | 89.05% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.72% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.51% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.80% | 86.33% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 86.75% | 92.94% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 86.46% | 96.61% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 86.27% | 95.89% |
CHEMBL2581 | P07339 | Cathepsin D | 86.16% | 98.95% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 85.65% | 92.88% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.13% | 94.75% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.23% | 95.50% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 82.84% | 91.24% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.03% | 91.71% |
CHEMBL233 | P35372 | Mu opioid receptor | 81.96% | 97.93% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 81.27% | 97.50% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.63% | 100.00% |
CHEMBL5524 | Q99873 | Protein-arginine N-methyltransferase 1 | 80.30% | 96.67% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 80.11% | 95.83% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum arundo |
PubChem | 163189743 |
LOTUS | LTS0091450 |
wikiData | Q104970243 |