(1R)-4-[(1E,3Z,5E,7E,9E,11E,13E,15Z,17E)-18-[(1R,4R)-4-hydroxy-2,6,6-trimethylcyclohex-2-en-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol
Internal ID | 6b322ead-b1b8-4a73-afc2-49b379eaba1e |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Tetraterpenoids > Carotenoids > Xanthophylls |
IUPAC Name | (1R)-4-[(1E,3Z,5E,7E,9E,11E,13E,15Z,17E)-18-[(1R,4R)-4-hydroxy-2,6,6-trimethylcyclohex-2-en-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol |
SMILES (Canonical) | CC1=C(C(CC(C1)O)(C)C)C=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC2C(=CC(CC2(C)C)O)C)C)C |
SMILES (Isomeric) | CC1=C(C(C[C@@H](C1)O)(C)C)/C=C/C(=C\C=C\C(=C\C=C\C=C(/C)\C=C\C=C(\C)/C=C/[C@H]2C(=C[C@@H](CC2(C)C)O)C)\C)/C |
InChI | InChI=1S/C40H56O2/c1-29(17-13-19-31(3)21-23-37-33(5)25-35(41)27-39(37,7)8)15-11-12-16-30(2)18-14-20-32(4)22-24-38-34(6)26-36(42)28-40(38,9)10/h11-25,35-37,41-42H,26-28H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,29-15+,30-16+,31-19-,32-20-/t35-,36+,37-/m0/s1 |
InChI Key | KBPHJBAIARWVSC-LPJYTASVSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C40H56O2 |
Molecular Weight | 568.90 g/mol |
Exact Mass | 568.42803102 g/mol |
Topological Polar Surface Area (TPSA) | 40.50 Ų |
XlogP | 11.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.50% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.94% | 91.11% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 92.94% | 83.82% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.80% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.58% | 86.33% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.95% | 94.75% |
CHEMBL1870 | P28702 | Retinoid X receptor beta | 85.51% | 95.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.27% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.86% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.20% | 95.89% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.04% | 92.94% |
CHEMBL2004 | P48443 | Retinoid X receptor gamma | 82.52% | 100.00% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 82.37% | 85.30% |
CHEMBL2061 | P19793 | Retinoid X receptor alpha | 81.35% | 91.67% |
CHEMBL2581 | P07339 | Cathepsin D | 81.33% | 98.95% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 81.10% | 90.24% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 80.63% | 92.97% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.54% | 91.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.12% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Brassica napus |
PubChem | 102093134 |
LOTUS | LTS0183291 |
wikiData | Q105138424 |