(7E,9R,10R,13E)-14,16,16-tribromo-9,10-dihydroxyhexadeca-7,13,15-trien-5-ynoic acid
| Internal ID | dd0c6dd8-071e-4669-9aac-48b7baf50d49 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acids and conjugates > Long-chain fatty acids |
| IUPAC Name | (7E,9R,10R,13E)-14,16,16-tribromo-9,10-dihydroxyhexadeca-7,13,15-trien-5-ynoic acid |
| SMILES (Canonical) | C(CC#CC=CC(C(CCC=C(C=C(Br)Br)Br)O)O)CC(=O)O |
| SMILES (Isomeric) | C(CC#C/C=C/[C@H]([C@@H](CC/C=C(\C=C(Br)Br)/Br)O)O)CC(=O)O |
| InChI | InChI=1S/C16H19Br3O4/c17-12(11-15(18)19)7-6-9-14(21)13(20)8-4-2-1-3-5-10-16(22)23/h4,7-8,11,13-14,20-21H,3,5-6,9-10H2,(H,22,23)/b8-4+,12-7+/t13-,14-/m1/s1 |
| InChI Key | LPFSGZGTAGPTBH-VBFSQMODSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H19Br3O4 |
| Molecular Weight | 515.00 g/mol |
| Exact Mass | 513.88130 g/mol |
| Topological Polar Surface Area (TPSA) | 77.80 Ų |
| XlogP | 3.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.06% | 90.17% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.95% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.74% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.78% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.05% | 96.09% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.62% | 100.00% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 87.53% | 96.38% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 84.51% | 83.82% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.83% | 96.00% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 83.42% | 89.05% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.60% | 93.56% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.07% | 91.19% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 80.95% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 56590255 |
| LOTUS | LTS0058458 |
| wikiData | Q105155152 |