(3aS,4R,5S,5aR,6R,8aS,8bR)-4,5-dihydroxy-6-(hydroxymethyl)-3,3,5a-trimethyl-3a,4,5,6,7,8,8a,8b-octahydrocyclopenta[g][2]benzofuran-1-one
| Internal ID | 3a67ef0c-9c97-493d-ad8d-850ad9e5d9ef |
| Taxonomy | Organoheterocyclic compounds > Lactones > Gamma butyrolactones |
| IUPAC Name | (3aS,4R,5S,5aR,6R,8aS,8bR)-4,5-dihydroxy-6-(hydroxymethyl)-3,3,5a-trimethyl-3a,4,5,6,7,8,8a,8b-octahydrocyclopenta[g][2]benzofuran-1-one |
| SMILES (Canonical) | CC1(C2C(C3CCC(C3(C(C2O)O)C)CO)C(=O)O1)C |
| SMILES (Isomeric) | C[C@]12[C@@H](CC[C@H]1[C@@H]3[C@@H]([C@H]([C@H]2O)O)C(OC3=O)(C)C)CO |
| InChI | InChI=1S/C15H24O5/c1-14(2)10-9(13(19)20-14)8-5-4-7(6-16)15(8,3)12(18)11(10)17/h7-12,16-18H,4-6H2,1-3H3/t7-,8-,9+,10-,11+,12+,15-/m0/s1 |
| InChI Key | XZZSMABCTFBPDJ-ZNKUNKHESA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16237386 g/mol |
| Topological Polar Surface Area (TPSA) | 87.00 Ų |
| XlogP | 0.40 |
| There are no found synonyms. |
![2D Structure of (3aS,4R,5S,5aR,6R,8aS,8bR)-4,5-dihydroxy-6-(hydroxymethyl)-3,3,5a-trimethyl-3a,4,5,6,7,8,8a,8b-octahydrocyclopenta[g][2]benzofuran-1-one](https://plantaedb.com/storage/docs/compounds/2023/11/7e9abc80-870c-11ee-891e-5d98608601ff.jpg "2D Structure of (3aS,4R,5S,5aR,6R,8aS,8bR)-4,5-dihydroxy-6-(hydroxymethyl)-3,3,5a-trimethyl-3a,4,5,6,7,8,8a,8b-octahydrocyclopenta[g][2]benzofuran-1-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.57% | 83.82% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.60% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.90% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.95% | 97.09% |
| CHEMBL1871 | P10275 | Androgen Receptor | 91.59% | 96.43% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.06% | 98.95% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.63% | 100.00% |
| CHEMBL4072 | P07858 | Cathepsin B | 88.76% | 93.67% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.54% | 97.25% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.89% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.64% | 89.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.35% | 95.89% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.83% | 93.04% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 81.63% | 95.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dendrobium findleyanum |
| PubChem | 162911020 |
| LOTUS | LTS0075169 |
| wikiData | Q105345268 |