8-[(2S,4S,5S)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,4S,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]-7-hydroxy-2-(4-hydroxyphenyl)chromen-4-one
Internal ID | eff5b9d4-ce13-45e1-bbed-e0772e44d910 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid C-glycosides > Flavonoid 8-C-glycosides |
IUPAC Name | 8-[(2S,4S,5S)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,4S,5R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]-7-hydroxy-2-(4-hydroxyphenyl)chromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(C(OC2C3=C(C=CC4=C3OC(=CC4=O)C5=CC=C(C=C5)O)O)CO)O)O)O)O)O |
SMILES (Isomeric) | CC1[C@@H]([C@@H](C([C@@H](O1)OC2[C@H]([C@@H](C(O[C@H]2C3=C(C=CC4=C3OC(=CC4=O)C5=CC=C(C=C5)O)O)CO)O)O)O)O)O |
InChI | InChI=1S/C27H30O13/c1-10-19(32)21(34)23(36)27(37-10)40-26-22(35)20(33)17(9-28)39-25(26)18-14(30)7-6-13-15(31)8-16(38-24(13)18)11-2-4-12(29)5-3-11/h2-8,10,17,19-23,25-30,32-36H,9H2,1H3/t10?,17?,19-,20+,21-,22-,23?,25-,26?,27-/m0/s1 |
InChI Key | QWQINSCQRIBWBV-ZEJISTGESA-N |
Popularity | 0 references in papers |
Molecular Formula | C27H30O13 |
Molecular Weight | 562.50 g/mol |
Exact Mass | 562.16864101 g/mol |
Topological Polar Surface Area (TPSA) | 216.00 Ų |
XlogP | -1.10 |
LMPK12110023 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.77% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.62% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.41% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.10% | 91.49% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 95.23% | 98.35% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.19% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.99% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.80% | 95.56% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.93% | 99.15% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 90.03% | 97.36% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.25% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.71% | 99.17% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 86.92% | 86.92% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 86.01% | 91.71% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 82.47% | 95.83% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 82.24% | 96.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Sophora tonkinensis |
PubChem | 44257570 |
LOTUS | LTS0210530 |
wikiData | Q105229340 |