2-[2-[2-[[15-(5,6-Dihydroxy-6-methylheptan-2-yl)-14-hydroxy-7,7,12,16-tetramethyl-9-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-4,5-dihydroxyoxan-3-yl]oxy-4,5-dihydroxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol
| Internal ID | 6c96490d-dfd9-4266-9ee7-052efc1bd1b8 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins > Cucurbitacin glycosides |
| IUPAC Name | 2-[2-[2-[[15-(5,6-dihydroxy-6-methylheptan-2-yl)-14-hydroxy-7,7,12,16-tetramethyl-9-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-4,5-dihydroxyoxan-3-yl]oxy-4,5-dihydroxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(COC2OC3C(C(COC3OC4CCC56CC57CCC8(C(C(CC8(C7CC(C6C4(C)C)OC9C(C(C(C(O9)CO)O)O)O)C)O)C(C)CCC(C(C)(C)O)O)C)O)O)O)O)O)O)O |
| SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(C(COC2OC3C(C(COC3OC4CCC56CC57CCC8(C(C(CC8(C7CC(C6C4(C)C)OC9C(C(C(C(O9)CO)O)O)O)C)O)C(C)CCC(C(C)(C)O)O)C)O)O)O)O)O)O)O |
| InChI | InChI=1S/C52H88O22/c1-21(9-10-29(57)48(5,6)66)31-23(54)16-50(8)28-15-26(70-44-39(65)37(63)35(61)27(17-53)71-44)42-47(3,4)30(11-12-52(42)20-51(28,52)14-13-49(31,50)7)72-45-40(33(59)24(55)18-67-45)74-46-41(34(60)25(56)19-68-46)73-43-38(64)36(62)32(58)22(2)69-43/h21-46,53-66H,9-20H2,1-8H3 |
| InChI Key | PHQNRQVODBXIOF-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C52H88O22 |
| Molecular Weight | 1065.20 g/mol |
| Exact Mass | 1064.57672443 g/mol |
| Topological Polar Surface Area (TPSA) | 357.00 Ų |
| XlogP | -1.10 |
| Atomic LogP (AlogP) | -2.12 |
| H-Bond Acceptor | 22 |
| H-Bond Donor | 14 |
| Rotatable Bonds | 14 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.4805 | 48.05% |
| Caco-2 | - | 0.8863 | 88.63% |
| Blood Brain Barrier | - | 0.5750 | 57.50% |
| Human oral bioavailability | - | 0.7571 | 75.71% |
| Subcellular localzation | Mitochondria | 0.5846 | 58.46% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8283 | 82.83% |
| OATP1B3 inhibitior | + | 0.9122 | 91.22% |
| MATE1 inhibitior | - | 0.9800 | 98.00% |
| OCT2 inhibitior | - | 0.5750 | 57.50% |
| BSEP inhibitior | + | 0.5833 | 58.33% |
| P-glycoprotein inhibitior | + | 0.7490 | 74.90% |
| P-glycoprotein substrate | + | 0.6279 | 62.79% |
| CYP3A4 substrate | + | 0.7324 | 73.24% |
| CYP2C9 substrate | - | 0.8018 | 80.18% |
| CYP2D6 substrate | - | 0.8301 | 83.01% |
| CYP3A4 inhibition | - | 0.9472 | 94.72% |
| CYP2C9 inhibition | - | 0.7996 | 79.96% |
| CYP2C19 inhibition | - | 0.8391 | 83.91% |
| CYP2D6 inhibition | - | 0.9505 | 95.05% |
| CYP1A2 inhibition | - | 0.8918 | 89.18% |
| CYP2C8 inhibition | + | 0.6914 | 69.14% |
| CYP inhibitory promiscuity | - | 0.9671 | 96.71% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.9700 | 97.00% |
| Carcinogenicity (trinary) | Non-required | 0.6868 | 68.68% |
| Eye corrosion | - | 0.9895 | 98.95% |
| Eye irritation | - | 0.9032 | 90.32% |
| Skin irritation | - | 0.7152 | 71.52% |
| Skin corrosion | - | 0.9483 | 94.83% |
| Ames mutagenesis | - | 0.6348 | 63.48% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7583 | 75.83% |
| Micronuclear | - | 0.8000 | 80.00% |
| Hepatotoxicity | - | 0.6997 | 69.97% |
| skin sensitisation | - | 0.9113 | 91.13% |
| Respiratory toxicity | + | 0.5111 | 51.11% |
| Reproductive toxicity | + | 0.7444 | 74.44% |
| Mitochondrial toxicity | - | 0.5875 | 58.75% |
| Nephrotoxicity | - | 0.9518 | 95.18% |
| Acute Oral Toxicity (c) | I | 0.6066 | 60.66% |
| Estrogen receptor binding | + | 0.7887 | 78.87% |
| Androgen receptor binding | + | 0.7449 | 74.49% |
| Thyroid receptor binding | - | 0.5273 | 52.73% |
| Glucocorticoid receptor binding | + | 0.6893 | 68.93% |
| Aromatase binding | + | 0.6377 | 63.77% |
| PPAR gamma | + | 0.7783 | 77.83% |
| Honey bee toxicity | - | 0.5866 | 58.66% |
| Biodegradation | - | 0.8000 | 80.00% |
| Crustacea aquatic toxicity | - | 0.6100 | 61.00% |
| Fish aquatic toxicity | + | 0.8024 | 80.24% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 99.61% | 97.25% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 98.70% | 95.58% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.47% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.84% | 97.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 95.44% | 95.93% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.29% | 96.09% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 94.90% | 92.88% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 93.18% | 94.75% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 92.82% | 96.61% |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 91.96% | 95.69% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.53% | 98.95% |
| CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 90.61% | 100.00% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 90.02% | 91.24% |
| CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 88.98% | 99.17% |
| CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 88.16% | 99.00% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 87.93% | 97.36% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 87.69% | 100.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.54% | 86.33% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.33% | 97.14% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.19% | 96.47% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 86.95% | 97.79% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 86.42% | 98.10% |
| CHEMBL4105786 | P41182 | B-cell lymphoma 6 protein | 86.20% | 92.86% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 86.10% | 92.86% |
| CHEMBL3589 | P55263 | Adenosine kinase | 85.83% | 98.05% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 85.54% | 96.77% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 85.50% | 90.24% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.20% | 89.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.50% | 92.94% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 84.04% | 97.86% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.85% | 91.07% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.68% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.60% | 95.89% |
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 83.43% | 92.78% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.41% | 96.21% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.31% | 94.45% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 83.23% | 98.75% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 82.96% | 97.29% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 82.95% | 98.05% |
| CHEMBL1977 | P11473 | Vitamin D receptor | 82.77% | 99.43% |
| CHEMBL233 | P35372 | Mu opioid receptor | 82.68% | 97.93% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 82.58% | 82.50% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.37% | 100.00% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.18% | 95.71% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 81.70% | 95.92% |
| CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 80.95% | 95.00% |
| CHEMBL344 | Q99705 | Melanin-concentrating hormone receptor 1 | 80.83% | 92.50% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 80.57% | 95.38% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.24% | 91.03% |
| CHEMBL4482 | O96013 | Serine/threonine-protein kinase PAK 4 | 80.16% | 95.42% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.02% | 93.18% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Astragalus aureus |
| Astragalus icmadophilus |
| PubChem | 162842262 |
| LOTUS | LTS0164017 |
| wikiData | Q105209170 |