2-[6-[[4a,6a,7-trimethyl-8-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-2,3,4,4b,5,6,11,11a,11b,12-decahydro-1H-indeno[2,1-a]phenanthren-2-yl]oxy]-4-hydroxy-2-(hydroxymethyl)-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | 8733f55f-58ce-413e-b255-7e13c7a8e68a |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
IUPAC Name | 2-[6-[[4a,6a,7-trimethyl-8-[3-methyl-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-2,3,4,4b,5,6,11,11a,11b,12-decahydro-1H-indeno[2,1-a]phenanthren-2-yl]oxy]-4-hydroxy-2-(hydroxymethyl)-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)OC3C(C(C(C(O3)C)O)O)O)OC4CCC5(C6CCC7(C(C6CC=C5C4)CC8=C7C(=C(C=C8)CCC(C)COC9C(C(C(C(O9)CO)O)O)O)C)C)C)CO)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)OC3C(C(C(C(O3)C)O)O)O)OC4CCC5(C6CCC7(C(C6CC=C5C4)CC8=C7C(=C(C=C8)CCC(C)COC9C(C(C(C(O9)CO)O)O)O)C)C)C)CO)O)O)O |
InChI | InChI=1S/C53H82O20/c1-22(21-66-48-42(62)41(61)38(58)33(19-54)70-48)7-8-26-9-10-27-17-32-30-12-11-28-18-29(13-15-52(28,5)31(30)14-16-53(32,6)35(27)23(26)2)69-51-47(73-50-44(64)40(60)37(57)25(4)68-50)45(65)46(34(20-55)71-51)72-49-43(63)39(59)36(56)24(3)67-49/h9-11,22,24-25,29-34,36-51,54-65H,7-8,12-21H2,1-6H3 |
InChI Key | NOPZMMFKMZPJSR-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C53H82O20 |
Molecular Weight | 1039.20 g/mol |
Exact Mass | 1038.53994500 g/mol |
Topological Polar Surface Area (TPSA) | 317.00 Ų |
XlogP | 0.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.58% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.47% | 91.11% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 98.05% | 89.05% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 95.36% | 97.36% |
CHEMBL2581 | P07339 | Cathepsin D | 95.01% | 98.95% |
CHEMBL233 | P35372 | Mu opioid receptor | 93.84% | 97.93% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 93.53% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.95% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.83% | 97.25% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.39% | 94.75% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 92.18% | 95.89% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.90% | 93.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.77% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.40% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.16% | 86.33% |
CHEMBL1907 | P15144 | Aminopeptidase N | 89.20% | 93.31% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 89.15% | 91.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.70% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.03% | 94.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.47% | 94.73% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 84.68% | 93.18% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.69% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.76% | 95.56% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.69% | 96.47% |
CHEMBL220 | P22303 | Acetylcholinesterase | 82.60% | 94.45% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.12% | 96.00% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 81.97% | 97.33% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.48% | 92.62% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 80.60% | 96.25% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum aethiopicum |
PubChem | 73821786 |
LOTUS | LTS0070133 |
wikiData | Q105182703 |