[3-acetyloxy-2-[[3,11-dihydroxy-17-(3-hydroxy-6-methylheptan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl]oxy]-5-hydroxy-6-methyloxan-4-yl] 3,4,5-trimethoxybenzoate
Internal ID | d500e5d2-a10a-491c-850f-e2f1172ef9c0 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | [3-acetyloxy-2-[[3,11-dihydroxy-17-(3-hydroxy-6-methylheptan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl]oxy]-5-hydroxy-6-methyloxan-4-yl] 3,4,5-trimethoxybenzoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2CC3C4CC=C5CC(CCC5(C4C(CC3(C2C(C)C(CCC(C)C)O)C)O)C)O)OC(=O)C)OC(=O)C6=CC(=C(C(=C6)OC)OC)OC)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2CC3C4CC=C5CC(CCC5(C4C(CC3(C2C(C)C(CCC(C)C)O)C)O)C)O)OC(=O)C)OC(=O)C6=CC(=C(C(=C6)OC)OC)OC)O |
InChI | InChI=1S/C45H68O13/c1-22(2)11-14-31(48)23(3)36-33(20-30-29-13-12-27-19-28(47)15-16-44(27,6)37(29)32(49)21-45(30,36)7)57-43-41(56-25(5)46)40(38(50)24(4)55-43)58-42(51)26-17-34(52-8)39(54-10)35(18-26)53-9/h12,17-18,22-24,28-33,36-38,40-41,43,47-50H,11,13-16,19-21H2,1-10H3 |
InChI Key | ZTZXQSZVCACSSK-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C45H68O13 |
Molecular Weight | 817.00 g/mol |
Exact Mass | 816.46599222 g/mol |
Topological Polar Surface Area (TPSA) | 180.00 Ų |
XlogP | 6.00 |
There are no found synonyms. |
![2D Structure of [3-acetyloxy-2-[[3,11-dihydroxy-17-(3-hydroxy-6-methylheptan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl]oxy]-5-hydroxy-6-methyloxan-4-yl] 3,4,5-trimethoxybenzoate 2D Structure of [3-acetyloxy-2-[[3,11-dihydroxy-17-(3-hydroxy-6-methylheptan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl]oxy]-5-hydroxy-6-methyloxan-4-yl] 3,4,5-trimethoxybenzoate](https://plantaedb.com/storage/docs/compounds/2023/11/7e276a30-8650-11ee-b34a-ff469a5030a8.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.78% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.54% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.30% | 91.11% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 97.94% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.53% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.09% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 95.14% | 98.95% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 93.75% | 89.50% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 93.39% | 92.98% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.69% | 100.00% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 91.69% | 95.93% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 90.03% | 97.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.71% | 99.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.96% | 95.89% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.58% | 91.19% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 88.58% | 91.07% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.30% | 97.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.10% | 96.00% |
CHEMBL204 | P00734 | Thrombin | 86.95% | 96.01% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.07% | 92.62% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.67% | 90.71% |
CHEMBL4208 | P20618 | Proteasome component C5 | 85.60% | 90.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.04% | 94.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.33% | 93.56% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 84.16% | 89.05% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.14% | 100.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.47% | 92.50% |
CHEMBL5747 | Q92793 | CREB-binding protein | 82.47% | 95.12% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.49% | 100.00% |
CHEMBL5028 | O14672 | ADAM10 | 80.72% | 97.50% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.57% | 94.73% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 80.37% | 98.05% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ornithogalum saundersiae |
PubChem | 85286921 |
LOTUS | LTS0103761 |
wikiData | Q105383422 |