(7E)-3-hydroxy-10-methoxy-14H-benzo[e][2]benzazecin-13-one
| Internal ID | 64fbd8b2-09a0-43d2-a259-e2135a299646 |
| Taxonomy | Alkaloids and derivatives > Protopine alkaloids |
| IUPAC Name | (7E)-3-hydroxy-10-methoxy-14H-benzo[e][2]benzazecin-13-one |
| SMILES (Canonical) | COC1=CC2=C(C=C1)C(=O)CC3=C(C=C(C=C3)O)C=NC=C2 |
| SMILES (Isomeric) | COC1=CC\2=C(C=C1)C(=O)CC3=C(C=C(C=C3)O)C=N/C=C2 |
| InChI | InChI=1S/C18H15NO3/c1-22-16-4-5-17-13(9-16)6-7-19-11-14-8-15(20)3-2-12(14)10-18(17)21/h2-9,11,20H,10H2,1H3/b7-6+,19-11? |
| InChI Key | BQMAYEDHEJQSJP-YNXZHIPHSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.10519334 g/mol |
| Topological Polar Surface Area (TPSA) | 58.90 Ų |
| XlogP | 2.60 |
| There are no found synonyms. |
![2D Structure of (7E)-3-hydroxy-10-methoxy-14H-benzo[e][2]benzazecin-13-one](https://plantaedb.com/storage/docs/compounds/2023/11/7e-3-hydroxy-10-methoxy-14h-benzoe2benzazecin-13-one.jpg "2D Structure of (7E)-3-hydroxy-10-methoxy-14H-benzo[e][2]benzazecin-13-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.72% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.91% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.53% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.35% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.10% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 93.79% | 90.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.98% | 99.15% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.01% | 99.17% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 91.88% | 93.31% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.92% | 85.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.71% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.01% | 94.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.53% | 98.75% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.13% | 95.89% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 86.30% | 92.67% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 84.50% | 92.51% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.09% | 95.89% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.45% | 91.07% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.34% | 99.23% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 80.12% | 93.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Aristolochia constricta |
| PubChem | 102091738 |
| LOTUS | LTS0137557 |
| wikiData | Q104944429 |