[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(E)-4-hydroxy-2-methylbut-2-enoxy]oxan-2-yl]methyl 4-hydroxybenzoate
Internal ID | b1dec929-37e0-44b5-b6d9-cc69b97c1136 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acyl glycosides > Fatty acyl glycosides of mono- and disaccharides |
IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(E)-4-hydroxy-2-methylbut-2-enoxy]oxan-2-yl]methyl 4-hydroxybenzoate |
SMILES (Canonical) | CC(=CCO)COC1C(C(C(C(O1)COC(=O)C2=CC=C(C=C2)O)O)O)O |
SMILES (Isomeric) | C/C(=C\CO)/CO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)COC(=O)C2=CC=C(C=C2)O)O)O)O |
InChI | InChI=1S/C18H24O9/c1-10(6-7-19)8-26-18-16(23)15(22)14(21)13(27-18)9-25-17(24)11-2-4-12(20)5-3-11/h2-6,13-16,18-23H,7-9H2,1H3/b10-6+/t13-,14-,15+,16-,18-/m1/s1 |
InChI Key | NNYUPPPAKLXEOF-HEFLOINYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C18H24O9 |
Molecular Weight | 384.40 g/mol |
Exact Mass | 384.14203234 g/mol |
Topological Polar Surface Area (TPSA) | 146.00 Ų |
XlogP | -0.50 |
There are no found synonyms. |
![2D Structure of [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(E)-4-hydroxy-2-methylbut-2-enoxy]oxan-2-yl]methyl 4-hydroxybenzoate 2D Structure of [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(E)-4-hydroxy-2-methylbut-2-enoxy]oxan-2-yl]methyl 4-hydroxybenzoate](https://plantaedb.com/storage/docs/compounds/2023/11/7dc986a0-8646-11ee-aeb1-492a984142bb.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.56% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.76% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.70% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.31% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.51% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 86.14% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 86.01% | 91.49% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.92% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.50% | 97.09% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 84.34% | 95.64% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.99% | 89.00% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 82.56% | 93.10% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.30% | 95.89% |
CHEMBL3194 | P02766 | Transthyretin | 81.56% | 90.71% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.39% | 92.50% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 81.29% | 94.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.74% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Hymenophyllum barbatum |
PubChem | 10905100 |
LOTUS | LTS0175158 |
wikiData | Q105182391 |