[4,15-Diacetyloxy-1-(acetyloxymethyl)-7,9-dihydroxy-5,9,12,12-tetramethyl-8-oxo-2-tetracyclo[8.5.0.03,7.011,13]pentadecanyl] benzoate
| Internal ID | 8a5e88a8-d818-45dd-ae5f-cee05fd25e92 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Tetracarboxylic acids and derivatives |
| IUPAC Name | [4,15-diacetyloxy-1-(acetyloxymethyl)-7,9-dihydroxy-5,9,12,12-tetramethyl-8-oxo-2-tetracyclo[8.5.0.03,7.011,13]pentadecanyl] benzoate |
| SMILES (Canonical) | CC1CC2(C(C1OC(=O)C)C(C3(C(CC4C(C3C(C2=O)(C)O)C4(C)C)OC(=O)C)COC(=O)C)OC(=O)C5=CC=CC=C5)O |
| SMILES (Isomeric) | CC1CC2(C(C1OC(=O)C)C(C3(C(CC4C(C3C(C2=O)(C)O)C4(C)C)OC(=O)C)COC(=O)C)OC(=O)C5=CC=CC=C5)O |
| InChI | InChI=1S/C33H42O11/c1-16-14-33(40)24(25(16)43-19(4)36)27(44-28(37)20-11-9-8-10-12-20)32(15-41-17(2)34)22(42-18(3)35)13-21-23(30(21,5)6)26(32)31(7,39)29(33)38/h8-12,16,21-27,39-40H,13-15H2,1-7H3 |
| InChI Key | CMOQMLYACDHGNV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C33H42O11 |
| Molecular Weight | 614.70 g/mol |
| Exact Mass | 614.27271215 g/mol |
| Topological Polar Surface Area (TPSA) | 163.00 Ų |
| XlogP | 3.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.08% | 85.14% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.89% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.47% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.69% | 98.95% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 94.71% | 82.69% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.56% | 90.17% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.11% | 97.25% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.12% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.89% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 88.76% | 91.49% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.49% | 99.23% |
| CHEMBL5028 | O14672 | ADAM10 | 86.90% | 97.50% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.51% | 97.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 86.45% | 83.82% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.76% | 93.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.95% | 91.07% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 81.25% | 97.79% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 81.03% | 96.67% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.83% | 97.14% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.71% | 95.89% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 80.21% | 89.34% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Euphorbia polycaulis |
| PubChem | 162845657 |
| LOTUS | LTS0084103 |
| wikiData | Q104667605 |