(2E,4R,7R)-4-methyl-7-prop-1-en-2-yl-2-[[(1R,7R,10R)-10,11,11-trimethyl-4-tricyclo[5.3.1.01,5]undec-4-enyl]methylidene]-5,6,7,8-tetrahydro-4H-azulene-1-carbaldehyde
| Internal ID | 5d3ac0c6-3d68-4320-84f2-349f60a0e805 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Guaianes |
| IUPAC Name | (2E,4R,7R)-4-methyl-7-prop-1-en-2-yl-2-[[(1R,7R,10R)-10,11,11-trimethyl-4-tricyclo[5.3.1.01,5]undec-4-enyl]methylidene]-5,6,7,8-tetrahydro-4H-azulene-1-carbaldehyde |
| SMILES (Canonical) | CC1CCC(CC2=C(C(=CC3=C4CC5CCC(C4(C5(C)C)CC3)C)C=C12)C=O)C(=C)C |
| SMILES (Isomeric) | C[C@@H]1CC[C@H](CC2=C(/C(=C/C3=C4C[C@H]5CC[C@H]([C@@]4(C5(C)C)CC3)C)/C=C12)C=O)C(=C)C |
| InChI | InChI=1S/C30H40O/c1-18(2)21-9-7-19(3)25-15-23(27(17-31)26(25)14-21)13-22-11-12-30-20(4)8-10-24(16-28(22)30)29(30,5)6/h13,15,17,19-21,24H,1,7-12,14,16H2,2-6H3/b23-13+/t19-,20-,21-,24-,30+/m1/s1 |
| InChI Key | MEIMTLGZEJLCSF-ZHLJVWIKSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H40O |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.307915895 g/mol |
| Topological Polar Surface Area (TPSA) | 17.10 Ų |
| XlogP | 7.00 |
| There are no found synonyms. |
![2D Structure of (2E,4R,7R)-4-methyl-7-prop-1-en-2-yl-2-[[(1R,7R,10R)-10,11,11-trimethyl-4-tricyclo[5.3.1.01,5]undec-4-enyl]methylidene]-5,6,7,8-tetrahydro-4H-azulene-1-carbaldehyde](https://plantaedb.com/storage/docs/compounds/2023/11/7dbb33e0-853e-11ee-9163-e7a7bf99ecc9.jpg "2D Structure of (2E,4R,7R)-4-methyl-7-prop-1-en-2-yl-2-[[(1R,7R,10R)-10,11,11-trimethyl-4-tricyclo[5.3.1.01,5]undec-4-enyl]methylidene]-5,6,7,8-tetrahydro-4H-azulene-1-carbaldehyde")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.94% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.93% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.68% | 96.09% |
| CHEMBL233 | P35372 | Mu opioid receptor | 92.75% | 97.93% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.78% | 98.95% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.38% | 92.94% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 89.35% | 97.05% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.88% | 95.56% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.47% | 97.25% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.30% | 100.00% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 84.08% | 92.97% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.26% | 95.89% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.27% | 94.45% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 81.16% | 97.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Joannesia princeps |
| PubChem | 10549854 |
| LOTUS | LTS0120563 |
| wikiData | Q105162257 |