[(2S,3R,4R,5S,6S)-5-hydroxy-2-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-7-yl]oxy-6-methyl-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl] 2-methylpropanoate
Internal ID | c137141d-e3a4-4d8e-97b2-a46a862352b2 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-7-O-glycosides |
IUPAC Name | [(2S,3R,4R,5S,6S)-5-hydroxy-2-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-7-yl]oxy-6-methyl-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl] 2-methylpropanoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=CC(=C3C(=C2)OC(=C(C3=O)OC4C(C(C(C(O4)CO)O)O)O)C5=CC=C(C=C5)O)O)OC(=O)C(C)C)OC6C(C(C(C(O6)CO)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC2=CC(=C3C(=C2)OC(=C(C3=O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)C5=CC=C(C=C5)O)O)OC(=O)C(C)C)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)O |
InChI | InChI=1S/C37H46O21/c1-12(2)34(50)56-33-31(57-35-28(48)26(46)23(43)19(10-38)54-35)22(42)13(3)51-37(33)52-16-8-17(41)21-18(9-16)53-30(14-4-6-15(40)7-5-14)32(25(21)45)58-36-29(49)27(47)24(44)20(11-39)55-36/h4-9,12-13,19-20,22-24,26-29,31,33,35-44,46-49H,10-11H2,1-3H3/t13-,19+,20+,22-,23+,24+,26-,27-,28+,29+,31+,33+,35-,36-,37-/m0/s1 |
InChI Key | CSYBRHUSDBRWOI-YXMIOGPTSA-N |
Popularity | 0 references in papers |
Molecular Formula | C37H46O21 |
Molecular Weight | 826.70 g/mol |
Exact Mass | 826.25315847 g/mol |
Topological Polar Surface Area (TPSA) | 331.00 Ų |
XlogP | -0.60 |
There are no found synonyms. |
![2D Structure of [(2S,3R,4R,5S,6S)-5-hydroxy-2-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-7-yl]oxy-6-methyl-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl] 2-methylpropanoate 2D Structure of [(2S,3R,4R,5S,6S)-5-hydroxy-2-[5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-7-yl]oxy-6-methyl-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl] 2-methylpropanoate](https://plantaedb.com/storage/docs/compounds/2023/11/7d9b16f0-8627-11ee-9e52-cf503b5b6ce4.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.60% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.52% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.94% | 89.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.64% | 91.49% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 95.54% | 99.15% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.24% | 94.00% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 93.34% | 95.64% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.14% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.88% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.99% | 85.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.88% | 99.17% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.32% | 94.73% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.82% | 90.71% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.09% | 94.45% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.65% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.29% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.68% | 95.56% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 84.12% | 97.36% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 84.10% | 94.80% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 83.12% | 96.21% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 81.96% | 95.78% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 80.96% | 93.10% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.79% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Sinocrassula indica |
PubChem | 102406383 |
LOTUS | LTS0084249 |
wikiData | Q104969635 |