[6-[3,5-Dihydroxy-2-[[2-hydroxy-9-(hydroxymethyl)-4,5,9,13,20,20-hexamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracos-15-en-10-yl]oxy]-6-methyloxan-4-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl acetate
Internal ID | 7b370ecd-23d4-4295-b482-d2a60649cff5 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | [6-[3,5-dihydroxy-2-[[2-hydroxy-9-(hydroxymethyl)-4,5,9,13,20,20-hexamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracos-15-en-10-yl]oxy]-6-methyloxan-4-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl acetate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2CCC3(C(C2(C)CO)CCC4(C3C=CC56C4(CC(C7(C5CC(CC7)(C)C)CO6)O)C)C)C)O)OC8C(C(C(C(O8)COC(=O)C)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2CCC3(C(C2(C)CO)CCC4(C3C=CC56C4(CC(C7(C5CC(CC7)(C)C)CO6)O)C)C)C)O)OC8C(C(C(C(O8)COC(=O)C)O)O)O)O |
InChI | InChI=1S/C44H70O14/c1-22-30(48)35(58-36-33(51)32(50)31(49)24(56-36)19-53-23(2)46)34(52)37(55-22)57-29-11-12-39(5)25(40(29,6)20-45)9-13-41(7)26(39)10-14-44-27-17-38(3,4)15-16-43(27,21-54-44)28(47)18-42(41,44)8/h10,14,22,24-37,45,47-52H,9,11-13,15-21H2,1-8H3 |
InChI Key | WDWZBAMDKXKRBA-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C44H70O14 |
Molecular Weight | 823.00 g/mol |
Exact Mass | 822.47655690 g/mol |
Topological Polar Surface Area (TPSA) | 214.00 Ų |
XlogP | 2.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.11% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.09% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.15% | 94.45% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 93.75% | 97.36% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 93.26% | 95.93% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.18% | 86.33% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.19% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.25% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.26% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.88% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.74% | 100.00% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 87.42% | 96.38% |
CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 86.97% | 97.47% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 86.58% | 95.00% |
CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 86.09% | 92.78% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.94% | 95.50% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 85.89% | 93.04% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.06% | 94.33% |
CHEMBL5028 | O14672 | ADAM10 | 83.00% | 97.50% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.94% | 92.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.66% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 82.16% | 98.95% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 81.27% | 97.53% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.91% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.29% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bupleurum falcatum |
Bupleurum kunmingense |
Bupleurum polyclonum |
Bupleurum rockii |
Clinopodium micranthum |
PubChem | 73818262 |
LOTUS | LTS0074728 |
wikiData | Q104402795 |