[(3S,4R,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]methyl 3,4,5-trihydroxy-2-[[(10R,11S,12R,13S,15R)-3,4,5,22,23-pentahydroxy-8,18-dioxo-11,12,13-tris[(3,4,5-trihydroxybenzoyl)oxy]-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(23),2,4,6,19,21-hexaen-21-yl]oxy]benzoate
| Internal ID | eb7db3a4-bf53-4711-8c68-1226a1312d2c |
| Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
| IUPAC Name | [(3S,4R,5S,6R)-2,3,4,5-tetrahydroxy-6-(hydroxymethyl)oxan-2-yl]methyl 3,4,5-trihydroxy-2-[[(10R,11S,12R,13S,15R)-3,4,5,22,23-pentahydroxy-8,18-dioxo-11,12,13-tris[(3,4,5-trihydroxybenzoyl)oxy]-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(23),2,4,6,19,21-hexaen-21-yl]oxy]benzoate |
| SMILES (Canonical) | C1C2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5)O)O)O)OC(=O)C6=CC(=C(C(=C6C7=C(C(=C(C=C7C(=O)O1)OC8=C(C(=C(C=C8C(=O)OCC9(C(C(C(C(O9)CO)O)O)O)O)O)O)O)O)O)O)O)O |
| SMILES (Isomeric) | C1[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5)O)O)O)OC(=O)C6=CC(=C(C(=C6C7=C(C(=C(C=C7C(=O)O1)OC8=C(C(=C(C=C8C(=O)OCC9([C@H]([C@@H]([C@@H]([C@H](O9)CO)O)O)O)O)O)O)O)O)O)O)O)O |
| InChI | InChI=1S/C55H46O37/c56-10-28-38(71)42(75)47(76)55(83,92-28)12-85-52(81)18-8-26(64)36(69)41(74)43(18)86-27-9-17-31(40(73)37(27)70)30-16(7-25(63)35(68)39(30)72)53(82)88-44-29(11-84-51(17)80)87-54(91-50(79)15-5-23(61)34(67)24(62)6-15)46(90-49(78)14-3-21(59)33(66)22(60)4-14)45(44)89-48(77)13-1-19(57)32(65)20(58)2-13/h1-9,28-29,38,42,44-47,54,56-76,83H,10-12H2/t28-,29-,38-,42-,44-,45+,46-,47+,54+,55?/m1/s1 |
| InChI Key | WRSQLXRSPQPQJJ-VUMLOPBKSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C55H46O37 |
| Molecular Weight | 1298.90 g/mol |
| Exact Mass | 1298.1717924 g/mol |
| Topological Polar Surface Area (TPSA) | 631.00 Ų |
| XlogP | -1.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.36% | 91.11% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 98.80% | 95.17% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 96.94% | 94.45% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.91% | 94.00% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 95.35% | 83.00% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 92.95% | 96.21% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 92.73% | 89.63% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.21% | 91.49% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.74% | 86.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.72% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.25% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.65% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.63% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.20% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.32% | 99.17% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 87.92% | 99.15% |
| CHEMBL3194 | P02766 | Transthyretin | 87.87% | 90.71% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.62% | 96.09% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 86.89% | 98.75% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 85.57% | 94.00% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 84.62% | 97.79% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.44% | 90.00% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.07% | 86.92% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.79% | 91.07% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.77% | 92.50% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.50% | 100.00% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 82.45% | 94.42% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.75% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Coriaria japonica |
| PubChem | 101629041 |
| LOTUS | LTS0183263 |
| wikiData | Q105311553 |