[(1S,3S,8S)-2,7,9,10,13-pentaacetyloxy-8,12,15,15-tetramethyl-4-methylidene-5-tricyclo[9.3.1.03,8]pentadec-11-enyl] 3-phenylprop-2-enoate
Internal ID | 19608094-0031-4f03-9c5a-c528dc4dfc68 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Taxanes and derivatives |
IUPAC Name | [(1S,3S,8S)-2,7,9,10,13-pentaacetyloxy-8,12,15,15-tetramethyl-4-methylidene-5-tricyclo[9.3.1.03,8]pentadec-11-enyl] 3-phenylprop-2-enoate |
SMILES (Canonical) | CC1=C2C(C(C3(C(CC(C(=C)C3C(C(C2(C)C)CC1OC(=O)C)OC(=O)C)OC(=O)C=CC4=CC=CC=C4)OC(=O)C)C)OC(=O)C)OC(=O)C |
SMILES (Isomeric) | CC1=C2C(C([C@]3([C@@H](C([C@H](C2(C)C)CC1OC(=O)C)OC(=O)C)C(=C)C(CC3OC(=O)C)OC(=O)C=CC4=CC=CC=C4)C)OC(=O)C)OC(=O)C |
InChI | InChI=1S/C39H48O12/c1-20-29(46-22(3)40)18-28-35(48-24(5)42)34-21(2)30(51-32(45)17-16-27-14-12-11-13-15-27)19-31(47-23(4)41)39(34,10)37(50-26(7)44)36(49-25(6)43)33(20)38(28,8)9/h11-17,28-31,34-37H,2,18-19H2,1,3-10H3/t28-,29?,30?,31?,34-,35?,36?,37?,39-/m1/s1 |
InChI Key | LNTSYHPESCVWKP-HBJFBIETSA-N |
Popularity | 0 references in papers |
Molecular Formula | C39H48O12 |
Molecular Weight | 708.80 g/mol |
Exact Mass | 708.31457696 g/mol |
Topological Polar Surface Area (TPSA) | 158.00 Ų |
XlogP | 4.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.53% | 86.33% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 96.89% | 94.62% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 96.80% | 95.50% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.71% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.46% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.77% | 95.56% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.05% | 90.17% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 90.56% | 94.08% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.27% | 96.00% |
CHEMBL2581 | P07339 | Cathepsin D | 88.08% | 98.95% |
CHEMBL5028 | O14672 | ADAM10 | 86.85% | 97.50% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.63% | 93.00% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 85.56% | 89.44% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.05% | 89.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.41% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Taxus brevifolia |
Taxus canadensis |
Taxus cuspidata |
Taxus mairei |
Taxus wallichiana var. chinensis |
PubChem | 137706335 |
LOTUS | LTS0074020 |
wikiData | Q104247053 |