6-Amino-2-[[6-amino-2-[[2-[[2-[[2-[[2-[[6-amino-2-[[2-[[2-[[2-[[5-(diaminomethylideneamino)-2-[[2-[[2-[[2-[2-[[2-(2,3-dihydroxypropanoylamino)-4-methylpentanoyl]amino]propanoylamino]-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]-3-methylpentanoyl]amino]pentanoyl]amino]-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]-3-methylbutanoyl]amino]hexanoyl]amino]-4-methylpentanoyl]amino]-3-hydroxybutanoyl]amino]-4-methylpentanoyl]amino]-3-hydroxybutanoyl]amino]hexanoyl]amino]hexanoic acid
| Internal ID | 10946089-f3f2-470c-90c6-20d3f6a42ea0 |
| Taxonomy | Organic Polymers > Polypeptides |
| IUPAC Name | 6-amino-2-[[6-amino-2-[[2-[[2-[[2-[[2-[[6-amino-2-[[2-[[2-[[2-[[5-(diaminomethylideneamino)-2-[[2-[[2-[[2-[2-[[2-(2,3-dihydroxypropanoylamino)-4-methylpentanoyl]amino]propanoylamino]-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]-3-methylpentanoyl]amino]pentanoyl]amino]-4-methylpentanoyl]amino]-4-methylpentanoyl]amino]-3-methylbutanoyl]amino]hexanoyl]amino]-4-methylpentanoyl]amino]-3-hydroxybutanoyl]amino]-4-methylpentanoyl]amino]-3-hydroxybutanoyl]amino]hexanoyl]amino]hexanoic acid |
| SMILES (Canonical) | CCC(C)C(C(=O)NC(CCCN=C(N)N)C(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)NC(C(C)C)C(=O)NC(CCCCN)C(=O)NC(CC(C)C)C(=O)NC(C(C)O)C(=O)NC(CC(C)C)C(=O)NC(C(C)O)C(=O)NC(CCCCN)C(=O)NC(CCCCN)C(=O)O)NC(=O)C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CC(C)C)NC(=O)C(CO)O |
| SMILES (Isomeric) | CCC(C)C(C(=O)NC(CCCN=C(N)N)C(=O)NC(CC(C)C)C(=O)NC(CC(C)C)C(=O)NC(C(C)C)C(=O)NC(CCCCN)C(=O)NC(CC(C)C)C(=O)NC(C(C)O)C(=O)NC(CC(C)C)C(=O)NC(C(C)O)C(=O)NC(CCCCN)C(=O)NC(CCCCN)C(=O)O)NC(=O)C(CC(C)C)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CC(C)C)NC(=O)C(CO)O |
| InChI | InChI=1S/C91H170N22O22/c1-22-54(18)71(111-82(126)66(42-50(10)11)107-79(123)63(39-47(4)5)103-74(118)55(19)98-78(122)62(38-46(2)3)108-85(129)69(117)45-114)87(131)100-60(33-29-37-97-91(95)96)77(121)104-64(40-48(6)7)80(124)106-65(41-49(8)9)81(125)110-70(53(16)17)86(130)99-59(31-24-27-35-93)76(120)105-67(43-51(12)13)83(127)113-73(57(21)116)89(133)109-68(44-52(14)15)84(128)112-72(56(20)115)88(132)101-58(30-23-26-34-92)75(119)102-61(90(134)135)32-25-28-36-94/h46-73,114-117H,22-45,92-94H2,1-21H3,(H,98,122)(H,99,130)(H,100,131)(H,101,132)(H,102,119)(H,103,118)(H,104,121)(H,105,120)(H,106,124)(H,107,123)(H,108,129)(H,109,133)(H,110,125)(H,111,126)(H,112,128)(H,113,127)(H,134,135)(H4,95,96,97) |
| InChI Key | ADWNNLGWJIZCSE-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C91H170N22O22 |
| Molecular Weight | 1924.50 g/mol |
| Exact Mass | 1923.28600514 g/mol |
| Topological Polar Surface Area (TPSA) | 726.00 Ų |
| XlogP | 0.50 |
| Atomic LogP (AlogP) | -2.57 |
| H-Bond Acceptor | 25 |
| H-Bond Donor | 26 |
| Rotatable Bonds | 69 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.5790 | 57.90% |
| Caco-2 | - | 0.8584 | 85.84% |
| Blood Brain Barrier | - | 0.5250 | 52.50% |
| Human oral bioavailability | - | 0.6429 | 64.29% |
| Subcellular localzation | Mitochondria | 0.6647 | 66.47% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8807 | 88.07% |
| OATP1B3 inhibitior | + | 0.9338 | 93.38% |
| MATE1 inhibitior | - | 0.8800 | 88.00% |
| OCT2 inhibitior | - | 0.8500 | 85.00% |
| BSEP inhibitior | + | 0.9329 | 93.29% |
| P-glycoprotein inhibitior | + | 0.7416 | 74.16% |
| P-glycoprotein substrate | + | 0.8372 | 83.72% |
| CYP3A4 substrate | + | 0.6515 | 65.15% |
| CYP2C9 substrate | - | 0.5983 | 59.83% |
| CYP2D6 substrate | - | 0.8231 | 82.31% |
| CYP3A4 inhibition | - | 0.8652 | 86.52% |
| CYP2C9 inhibition | - | 0.8525 | 85.25% |
| CYP2C19 inhibition | - | 0.7935 | 79.35% |
| CYP2D6 inhibition | - | 0.8855 | 88.55% |
| CYP1A2 inhibition | - | 0.8338 | 83.38% |
| CYP2C8 inhibition | - | 0.6169 | 61.69% |
| CYP inhibitory promiscuity | - | 0.9731 | 97.31% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.8411 | 84.11% |
| Carcinogenicity (trinary) | Non-required | 0.6149 | 61.49% |
| Eye corrosion | - | 0.9825 | 98.25% |
| Eye irritation | - | 0.8954 | 89.54% |
| Skin irritation | - | 0.8005 | 80.05% |
| Skin corrosion | - | 0.9371 | 93.71% |
| Ames mutagenesis | - | 0.5700 | 57.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6991 | 69.91% |
| Micronuclear | + | 0.6100 | 61.00% |
| Hepatotoxicity | - | 0.5416 | 54.16% |
| skin sensitisation | - | 0.8445 | 84.45% |
| Respiratory toxicity | + | 0.7333 | 73.33% |
| Reproductive toxicity | + | 0.5281 | 52.81% |
| Mitochondrial toxicity | + | 0.5625 | 56.25% |
| Nephrotoxicity | + | 0.8243 | 82.43% |
| Acute Oral Toxicity (c) | III | 0.6578 | 65.78% |
| Estrogen receptor binding | + | 0.5655 | 56.55% |
| Androgen receptor binding | + | 0.7143 | 71.43% |
| Thyroid receptor binding | + | 0.6765 | 67.65% |
| Glucocorticoid receptor binding | + | 0.7659 | 76.59% |
| Aromatase binding | + | 0.7709 | 77.09% |
| PPAR gamma | + | 0.7671 | 76.71% |
| Honey bee toxicity | - | 0.8318 | 83.18% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | - | 0.7100 | 71.00% |
| Fish aquatic toxicity | - | 0.8225 | 82.25% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3837 | P07711 | Cathepsin L | 99.84% | 96.61% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.10% | 98.95% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 98.69% | 93.56% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 98.69% | 98.94% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.04% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.98% | 96.09% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 97.73% | 100.00% |
| CHEMBL3776 | Q14790 | Caspase-8 | 97.23% | 97.06% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 96.68% | 98.05% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 96.51% | 100.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.15% | 96.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.06% | 99.17% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.34% | 90.17% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 94.80% | 96.47% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 94.60% | 87.45% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 94.53% | 98.10% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 94.14% | 97.29% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 93.79% | 97.23% |
| CHEMBL3308 | P55212 | Caspase-6 | 93.73% | 97.56% |
| CHEMBL236 | P41143 | Delta opioid receptor | 93.60% | 99.35% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 93.60% | 98.33% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 91.85% | 96.67% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 91.70% | 88.42% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 91.47% | 98.03% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 91.14% | 100.00% |
| CHEMBL3176 | O43603 | Galanin receptor 2 | 89.20% | 98.89% |
| CHEMBL2095164 | P49354 | Geranylgeranyl transferase type I | 88.76% | 92.80% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.99% | 90.71% |
| CHEMBL3286 | P00749 | Urokinase-type plasminogen activator | 87.90% | 97.88% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 87.75% | 95.58% |
| CHEMBL4072 | P07858 | Cathepsin B | 87.21% | 93.67% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 86.65% | 97.64% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.43% | 91.11% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 86.24% | 95.17% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 85.98% | 93.18% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 85.00% | 93.10% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 85.00% | 90.20% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 84.74% | 92.32% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.51% | 93.00% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 84.17% | 95.71% |
| CHEMBL204 | P00734 | Thrombin | 83.62% | 96.01% |
| CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 83.58% | 96.37% |
| CHEMBL5028 | O14672 | ADAM10 | 83.25% | 97.50% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 82.67% | 92.88% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 82.25% | 95.52% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.19% | 89.50% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.66% | 91.19% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 81.53% | 97.21% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 81.48% | 89.63% |
| CHEMBL3018 | Q9Y5Y6 | Matriptase | 80.84% | 98.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162816187 |
| LOTUS | LTS0210278 |
| wikiData | Q103816025 |