2-Hydroxy-7-(1-hydroxyethylidene)-10,15,15-trimethyl-16-oxa-10-azatetracyclo[9.8.0.03,9.012,17]nonadeca-1,3(9),4,11,13,17-hexaene-6,8,19-trione
| Internal ID | 2805b66b-807e-4242-8676-31a670c88231 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Chromenopyridines |
| IUPAC Name | 2-hydroxy-7-(1-hydroxyethylidene)-10,15,15-trimethyl-16-oxa-10-azatetracyclo[9.8.0.03,9.012,17]nonadeca-1,3(9),4,11,13,17-hexaene-6,8,19-trione |
| SMILES (Canonical) | CC(=C1C(=O)C=CC2=C(C1=O)N(C3=C4C=CC(OC4=CC(=O)C3=C2O)(C)C)C)O |
| SMILES (Isomeric) | CC(=C1C(=O)C=CC2=C(C1=O)N(C3=C4C=CC(OC4=CC(=O)C3=C2O)(C)C)C)O |
| InChI | InChI=1S/C22H19NO6/c1-10(24)16-13(25)6-5-12-19(21(16)28)23(4)18-11-7-8-22(2,3)29-15(11)9-14(26)17(18)20(12)27/h5-9,24,27H,1-4H3 |
| InChI Key | NZZKPLZIPBAKRI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H19NO6 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.12123733 g/mol |
| Topological Polar Surface Area (TPSA) | 104.00 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
![2D Structure of 2-Hydroxy-7-(1-hydroxyethylidene)-10,15,15-trimethyl-16-oxa-10-azatetracyclo[9.8.0.03,9.012,17]nonadeca-1,3(9),4,11,13,17-hexaene-6,8,19-trione](https://plantaedb.com/storage/docs/compounds/2023/11/7c369520-85cb-11ee-959a-09920e25d404.jpg "2D Structure of 2-Hydroxy-7-(1-hydroxyethylidene)-10,15,15-trimethyl-16-oxa-10-azatetracyclo[9.8.0.03,9.012,17]nonadeca-1,3(9),4,11,13,17-hexaene-6,8,19-trione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.82% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.24% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.99% | 94.45% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 96.82% | 91.49% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.01% | 89.00% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 92.70% | 94.42% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.29% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.77% | 85.14% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.14% | 96.77% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.85% | 90.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.54% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.17% | 94.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.45% | 93.99% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.75% | 99.23% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.18% | 99.15% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.68% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Citrus maxima |
| PubChem | 136863024 |
| LOTUS | LTS0262420 |
| wikiData | Q104396769 |