(1R,2R,4aR,4bS,6aS,7S,9R,10R,10aS,12aR)-2-acetyl-1-(carboxymethyl)-7,10-dihydroxy-1,4a,4b,9,10-pentamethyl-3,4,5,6,7,8,9,10a,12,12a-decahydro-2H-chrysene-6a-carboxylic acid
Internal ID | d85b28d3-e435-457a-a6b6-81e02a6fe6fd |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid acids > 3-carboxy steroids |
IUPAC Name | (1R,2R,4aR,4bS,6aS,7S,9R,10R,10aS,12aR)-2-acetyl-1-(carboxymethyl)-7,10-dihydroxy-1,4a,4b,9,10-pentamethyl-3,4,5,6,7,8,9,10a,12,12a-decahydro-2H-chrysene-6a-carboxylic acid |
SMILES (Canonical) | CC1CC(C2(CCC3(C(=CCC4C3(CCC(C4(C)CC(=O)O)C(=O)C)C)C2C1(C)O)C)C(=O)O)O |
SMILES (Isomeric) | C[C@@H]1C[C@@H]([C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@H]([C@]4(C)CC(=O)O)C(=O)C)C)[C@@H]2[C@]1(C)O)C)C(=O)O)O |
InChI | InChI=1S/C28H42O7/c1-15-13-20(30)28(23(33)34)12-11-25(4)18(22(28)27(15,6)35)7-8-19-24(3,14-21(31)32)17(16(2)29)9-10-26(19,25)5/h7,15,17,19-20,22,30,35H,8-14H2,1-6H3,(H,31,32)(H,33,34)/t15-,17+,19-,20+,22-,24+,25-,26-,27-,28-/m1/s1 |
InChI Key | ODUGZVUJDQKEQS-NOHCGYPKSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H42O7 |
Molecular Weight | 490.60 g/mol |
Exact Mass | 490.29305367 g/mol |
Topological Polar Surface Area (TPSA) | 132.00 Ų |
XlogP | 3.20 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.02% | 90.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.05% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.67% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 92.13% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.96% | 97.09% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.65% | 96.95% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.56% | 91.19% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.38% | 100.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.83% | 93.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.04% | 95.56% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 83.63% | 95.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.99% | 94.45% |
CHEMBL5028 | O14672 | ADAM10 | 81.07% | 97.50% |
CHEMBL1871 | P10275 | Androgen Receptor | 80.02% | 96.43% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Diospyros decandra |
PubChem | 11569424 |
LOTUS | LTS0220445 |
wikiData | Q105190046 |