8-[(2R,3R,4R,5R)-5-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-yl]-7-hydroxy-5-methyl-2-(2-oxopropyl)chromen-4-one
| Internal ID | eafe7ec1-9d20-4022-9799-238a67b271ad |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
| IUPAC Name | 8-[(2R,3R,4R,5R)-5-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-yl]-7-hydroxy-5-methyl-2-(2-oxopropyl)chromen-4-one |
| SMILES (Canonical) | CC1=CC(=C(C2=C1C(=O)C=C(O2)CC(=O)C)C3C(C(C(O3)C(CO)O)O)O)O |
| SMILES (Isomeric) | CC1=CC(=C(C2=C1C(=O)C=C(O2)CC(=O)C)[C@@H]3[C@@H]([C@H]([C@H](O3)[C@@H](CO)O)O)O)O |
| InChI | InChI=1S/C19H22O9/c1-7-3-10(22)14(19-16(26)15(25)17(28-19)12(24)6-20)18-13(7)11(23)5-9(27-18)4-8(2)21/h3,5,12,15-17,19-20,22,24-26H,4,6H2,1-2H3/t12-,15-,16-,17-,19-/m1/s1 |
| InChI Key | DAISPADBXDGVDW-QLXPXKAKSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H22O9 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.12638228 g/mol |
| Topological Polar Surface Area (TPSA) | 154.00 Ų |
| XlogP | -1.30 |
| Atomic LogP (AlogP) | -0.55 |
| H-Bond Acceptor | 9 |
| H-Bond Donor | 5 |
| Rotatable Bonds | 5 |
| There are no found synonyms. |
![2D Structure of 8-[(2R,3R,4R,5R)-5-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-yl]-7-hydroxy-5-methyl-2-(2-oxopropyl)chromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/7bf70410-8671-11ee-ae2b-edefef50bca0.jpg "2D Structure of 8-[(2R,3R,4R,5R)-5-[(1R)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-yl]-7-hydroxy-5-methyl-2-(2-oxopropyl)chromen-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.7694 | 76.94% |
| Caco-2 | - | 0.7922 | 79.22% |
| Blood Brain Barrier | - | 0.6500 | 65.00% |
| Human oral bioavailability | - | 0.6571 | 65.71% |
| Subcellular localzation | Mitochondria | 0.6565 | 65.65% |
| OATP2B1 inhibitior | - | 0.5667 | 56.67% |
| OATP1B1 inhibitior | + | 0.9064 | 90.64% |
| OATP1B3 inhibitior | + | 0.9581 | 95.81% |
| MATE1 inhibitior | - | 0.9400 | 94.00% |
| OCT2 inhibitior | - | 0.8500 | 85.00% |
| BSEP inhibitior | - | 0.6897 | 68.97% |
| P-glycoprotein inhibitior | - | 0.8294 | 82.94% |
| P-glycoprotein substrate | - | 0.6274 | 62.74% |
| CYP3A4 substrate | + | 0.5848 | 58.48% |
| CYP2C9 substrate | - | 0.5978 | 59.78% |
| CYP2D6 substrate | - | 0.8331 | 83.31% |
| CYP3A4 inhibition | - | 0.7182 | 71.82% |
| CYP2C9 inhibition | - | 0.7912 | 79.12% |
| CYP2C19 inhibition | - | 0.8687 | 86.87% |
| CYP2D6 inhibition | - | 0.9183 | 91.83% |
| CYP1A2 inhibition | - | 0.7500 | 75.00% |
| CYP2C8 inhibition | - | 0.7257 | 72.57% |
| CYP inhibitory promiscuity | - | 0.8161 | 81.61% |
| UGT catelyzed | - | 0.5000 | 50.00% |
| Carcinogenicity (binary) | - | 0.9600 | 96.00% |
| Carcinogenicity (trinary) | Non-required | 0.6170 | 61.70% |
| Eye corrosion | - | 0.9923 | 99.23% |
| Eye irritation | - | 0.9337 | 93.37% |
| Skin irritation | - | 0.8038 | 80.38% |
| Skin corrosion | - | 0.9405 | 94.05% |
| Ames mutagenesis | - | 0.5354 | 53.54% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.5958 | 59.58% |
| Micronuclear | + | 0.6100 | 61.00% |
| Hepatotoxicity | - | 0.7646 | 76.46% |
| skin sensitisation | - | 0.8537 | 85.37% |
| Respiratory toxicity | + | 0.5889 | 58.89% |
| Reproductive toxicity | + | 0.8778 | 87.78% |
| Mitochondrial toxicity | + | 0.7500 | 75.00% |
| Nephrotoxicity | - | 0.6988 | 69.88% |
| Acute Oral Toxicity (c) | III | 0.5838 | 58.38% |
| Estrogen receptor binding | + | 0.6597 | 65.97% |
| Androgen receptor binding | + | 0.6321 | 63.21% |
| Thyroid receptor binding | - | 0.6943 | 69.43% |
| Glucocorticoid receptor binding | + | 0.5998 | 59.98% |
| Aromatase binding | - | 0.5749 | 57.49% |
| PPAR gamma | - | 0.5230 | 52.30% |
| Honey bee toxicity | - | 0.8669 | 86.69% |
| Biodegradation | - | 0.7500 | 75.00% |
| Crustacea aquatic toxicity | - | 0.7600 | 76.00% |
| Fish aquatic toxicity | + | 0.8797 | 87.97% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.74% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.36% | 98.95% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 95.05% | 96.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.89% | 89.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 93.81% | 94.73% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.15% | 95.56% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 90.48% | 97.21% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.70% | 86.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.29% | 99.17% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 84.98% | 83.82% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.02% | 90.71% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 83.60% | 93.65% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.47% | 99.23% |
| PubChem | 102445577 |
| LOTUS | LTS0273425 |
| wikiData | Q104973629 |