methyl (1R,3aS,5aS,5bR,7aR,9S,11aR,11bR,13aR,13bR)-5a-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxymethyl]-9-hydroxy-5b,8,8,11a-tetramethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylate
Internal ID | a455348f-017d-4d5a-8236-59ee7b7995a9 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | methyl (1R,3aS,5aS,5bR,7aR,9S,11aR,11bR,13aR,13bR)-5a-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxymethyl]-9-hydroxy-5b,8,8,11a-tetramethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-3a-carboxylate |
SMILES (Canonical) | CC(=C)C1CCC2(C1C3CCC4C5(CCC(C(C5CCC4(C3(CC2)COC(=O)C=CC6=CC(=C(C=C6)O)O)C)(C)C)O)C)C(=O)OC |
SMILES (Isomeric) | CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]3CC[C@@H]4[C@]5(CC[C@@H](C([C@@H]5CC[C@]4([C@@]3(CC2)COC(=O)/C=C/C6=CC(=C(C=C6)O)O)C)(C)C)O)C)C(=O)OC |
InChI | InChI=1S/C40H56O7/c1-24(2)26-14-19-39(35(45)46-7)20-21-40(23-47-33(44)13-9-25-8-11-28(41)29(42)22-25)27(34(26)39)10-12-31-37(5)17-16-32(43)36(3,4)30(37)15-18-38(31,40)6/h8-9,11,13,22,26-27,30-32,34,41-43H,1,10,12,14-21,23H2,2-7H3/b13-9+/t26-,27+,30-,31+,32-,34+,37-,38+,39-,40-/m0/s1 |
InChI Key | SDHJQTVVRKHROZ-JSFQDESESA-N |
Popularity | 1 reference in papers |
Molecular Formula | C40H56O7 |
Molecular Weight | 648.90 g/mol |
Exact Mass | 648.40260412 g/mol |
Topological Polar Surface Area (TPSA) | 113.00 Ų |
XlogP | 9.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.70% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.25% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.10% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.23% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.14% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 91.24% | 98.95% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.88% | 90.17% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.30% | 95.56% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 89.86% | 91.49% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.49% | 92.94% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.57% | 95.89% |
CHEMBL233 | P35372 | Mu opioid receptor | 87.08% | 97.93% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.32% | 89.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.29% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.64% | 91.19% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.60% | 96.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.29% | 100.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 83.61% | 92.62% |
CHEMBL5028 | O14672 | ADAM10 | 83.49% | 97.50% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 82.19% | 97.33% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.54% | 96.90% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 80.89% | 97.79% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 80.40% | 94.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.07% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Durio zibethinus |
PubChem | 102242317 |
LOTUS | LTS0077974 |
wikiData | Q105250644 |