7a-[4-[3-(1,3-Benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-2-methoxyphenoxy]-6-[6-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-7-hydroxy-6,7-dihydro-1,3-benzodioxol-5-one
Internal ID | 7a3e640f-ff25-4196-b7c2-3b877736c572 |
Taxonomy | Lignans, neolignans and related compounds > Furanoid lignans |
IUPAC Name | 7a-[4-[3-(1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-2-methoxyphenoxy]-6-[6-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-7-hydroxy-6,7-dihydro-1,3-benzodioxol-5-one |
SMILES (Canonical) | COC1=C(C=C(C=C1)C2C3COC(C3CO2)C4C(C5(C(=CC4=O)OCO5)OC6=C(C=C(C=C6)C7C8COC(C8CO7)C9=CC1=C(C=C9)OCO1)OC)O)OC |
SMILES (Isomeric) | COC1=C(C=C(C=C1)C2C3COC(C3CO2)C4C(C5(C(=CC4=O)OCO5)OC6=C(C=C(C=C6)C7C8COC(C8CO7)C9=CC1=C(C=C9)OCO1)OC)O)OC |
InChI | InChI=1S/C41H42O14/c1-44-28-7-4-20(10-31(28)45-2)37-25-16-50-39(26(25)17-49-37)35-27(42)13-34-41(40(35)43,54-19-53-34)55-30-9-6-21(11-32(30)46-3)36-23-14-48-38(24(23)15-47-36)22-5-8-29-33(12-22)52-18-51-29/h4-13,23-26,35-40,43H,14-19H2,1-3H3 |
InChI Key | XZCCFCCPSAPCOZ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C41H42O14 |
Molecular Weight | 758.80 g/mol |
Exact Mass | 758.25745601 g/mol |
Topological Polar Surface Area (TPSA) | 148.00 Ų |
XlogP | 2.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.51% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.28% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.50% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.75% | 95.56% |
CHEMBL240 | Q12809 | HERG | 94.63% | 89.76% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.42% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 92.51% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.49% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.47% | 89.00% |
CHEMBL2535 | P11166 | Glucose transporter | 90.80% | 98.75% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.07% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.62% | 94.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 88.56% | 92.94% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.23% | 92.62% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.97% | 100.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.34% | 97.14% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 83.75% | 96.77% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.78% | 96.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.08% | 91.19% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.00% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Zanthoxylum simulans |
PubChem | 75586978 |
LOTUS | LTS0244371 |
wikiData | Q105344841 |