5-Chloro-16-(4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl)-4,13,17-trihydroxy-10,20-dimethyl-14-oxapentacyclo[11.6.1.02,11.05,10.017,20]icos-7-en-9-one
Internal ID | 7f9d86d9-8199-4702-8130-847b648667b1 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones |
IUPAC Name | 5-chloro-16-(4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl)-4,13,17-trihydroxy-10,20-dimethyl-14-oxapentacyclo[11.6.1.02,11.05,10.017,20]icos-7-en-9-one |
SMILES (Canonical) | CC1=C(C(=O)OC(C1)C2COC3(CC4C(CC(C5(C4(C(=O)C=CC5)C)Cl)O)C6C3(C2(CC6)O)C)O)C |
SMILES (Isomeric) | CC1=C(C(=O)OC(C1)C2COC3(CC4C(CC(C5(C4(C(=O)C=CC5)C)Cl)O)C6C3(C2(CC6)O)C)O)C |
InChI | InChI=1S/C28H37ClO7/c1-14-10-20(36-23(32)15(14)2)19-13-35-28(34)12-18-16(17-7-9-27(19,33)25(17,28)4)11-22(31)26(29)8-5-6-21(30)24(18,26)3/h5-6,16-20,22,31,33-34H,7-13H2,1-4H3 |
InChI Key | GLSQHTYIOIWXHF-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C28H37ClO7 |
Molecular Weight | 521.00 g/mol |
Exact Mass | 520.2227812 g/mol |
Topological Polar Surface Area (TPSA) | 113.00 Ų |
XlogP | 2.20 |
There are no found synonyms. |
![2D Structure of 5-Chloro-16-(4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl)-4,13,17-trihydroxy-10,20-dimethyl-14-oxapentacyclo[11.6.1.02,11.05,10.017,20]icos-7-en-9-one 2D Structure of 5-Chloro-16-(4,5-dimethyl-6-oxo-2,3-dihydropyran-2-yl)-4,13,17-trihydroxy-10,20-dimethyl-14-oxapentacyclo[11.6.1.02,11.05,10.017,20]icos-7-en-9-one](https://plantaedb.com/storage/docs/compounds/2023/11/7b8796a0-85b5-11ee-9ba0-ff9581ed82ed.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.96% | 85.14% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.79% | 91.11% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 92.41% | 100.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.63% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.78% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.53% | 86.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.51% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.02% | 96.09% |
CHEMBL204 | P00734 | Thrombin | 88.93% | 96.01% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.79% | 94.75% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.49% | 97.14% |
CHEMBL1871 | P10275 | Androgen Receptor | 85.24% | 96.43% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.86% | 99.23% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.73% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.83% | 95.89% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.06% | 93.03% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.76% | 97.25% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.72% | 93.04% |
CHEMBL299 | P17252 | Protein kinase C alpha | 80.47% | 98.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Jaborosa rotacea |
PubChem | 73024668 |
LOTUS | LTS0202067 |
wikiData | Q105011251 |