[(1aS,4aS,5R,7aR,7bR)-5-methoxy-3,3,7b-trimethyl-1,1a,2,4,4a,6,7,7a-octahydrocyclopropa[e]azulen-5-yl]methanol
| Internal ID | f453b838-88b8-4048-8295-a67e952a09f2 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | [(1aS,4aS,5R,7aR,7bR)-5-methoxy-3,3,7b-trimethyl-1,1a,2,4,4a,6,7,7a-octahydrocyclopropa[e]azulen-5-yl]methanol |
| SMILES (Canonical) | CC1(CC2CC2(C3CCC(C3C1)(CO)OC)C)C |
| SMILES (Isomeric) | C[C@@]12C[C@@H]1CC(C[C@H]3[C@H]2CC[C@@]3(CO)OC)(C)C |
| InChI | InChI=1S/C16H28O2/c1-14(2)7-11-8-15(11,3)12-5-6-16(10-17,18-4)13(12)9-14/h11-13,17H,5-10H2,1-4H3/t11-,12+,13-,15+,16-/m0/s1 |
| InChI Key | CCPVUWMQECWTHT-ABNPOPBRSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.39 g/mol |
| Exact Mass | 252.208930132 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 3.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.02% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.53% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.86% | 97.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.85% | 91.11% |
| CHEMBL1871 | P10275 | Androgen Receptor | 87.50% | 96.43% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.06% | 95.89% |
| CHEMBL204 | P00734 | Thrombin | 85.64% | 96.01% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.45% | 94.45% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.45% | 100.00% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 84.54% | 91.03% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.69% | 92.62% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 81.36% | 92.88% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.31% | 95.50% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.16% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 21670084 |
| LOTUS | LTS0188135 |
| wikiData | Q104953646 |