(E)-31-[6-[6-[6-[(3E,14E,16E)-17-chloro-1,2-dihydroxyheptadeca-3,14,16-trienyl]-4,5-dihydroxyoxan-2-yl]-1,5,6-trihydroxy-4-methylidenehexyl]-3,4,5-trihydroxyoxan-2-yl]-16,21,28-trimethylhentriacont-4-ene-1,2,6,10,14,17,18,22,23,24,29,30-dodecol
| Internal ID | 3eede00e-2087-4633-bd38-169d9e1a12da |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > C-glycosyl compounds |
| IUPAC Name | (E)-31-[6-[6-[6-[(3E,14E,16E)-17-chloro-1,2-dihydroxyheptadeca-3,14,16-trienyl]-4,5-dihydroxyoxan-2-yl]-1,5,6-trihydroxy-4-methylidenehexyl]-3,4,5-trihydroxyoxan-2-yl]-16,21,28-trimethylhentriacont-4-ene-1,2,6,10,14,17,18,22,23,24,29,30-dodecol |
| SMILES (Canonical) | CC(CCCC(C(C(C(C)CCC(C(C(C)CC(CCCC(CCCC(C=CCC(CO)O)O)O)O)O)O)O)O)O)C(C(CC1C(C(C(C(O1)C(CCC(=C)C(C(C2CC(C(C(O2)C(C(C=CCCCCCCCCCC=CC=CCl)O)O)O)O)O)O)O)O)O)O)O)O |
| SMILES (Isomeric) | CC(CCCC(C(C(C(C)CCC(C(C(C)CC(CCCC(CCCC(/C=C/CC(CO)O)O)O)O)O)O)O)O)O)C(C(CC1C(C(C(C(O1)C(CCC(=C)C(C(C2CC(C(C(O2)C(C(/C=C/CCCCCCCCC/C=C/C=C/Cl)O)O)O)O)O)O)O)O)O)O)O)O |
| InChI | InChI=1S/C68H123ClO24/c1-40(22-18-30-48(75)60(85)58(83)41(2)31-33-50(77)57(82)43(4)36-46(73)27-20-25-44(71)23-19-24-45(72)26-21-28-47(74)39-70)56(81)52(79)37-55-64(89)65(90)66(91)67(92-55)51(78)34-32-42(3)59(84)63(88)54-38-53(80)62(87)68(93-54)61(86)49(76)29-16-14-12-10-8-6-5-7-9-11-13-15-17-35-69/h13,15-17,21,26,29,35,40-41,43-68,70-91H,3,5-12,14,18-20,22-25,27-28,30-34,36-39H2,1-2,4H3/b15-13+,26-21+,29-16+,35-17+ |
| InChI Key | RXBCYWZWCKIJBH-DBBKABBASA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C68H123ClO24 |
| Molecular Weight | 1360.10 g/mol |
| Exact Mass | 1358.8092825 g/mol |
| Topological Polar Surface Area (TPSA) | 464.00 Ų |
| XlogP | 3.40 |
| Atomic LogP (AlogP) | 1.12 |
| H-Bond Acceptor | 24 |
| H-Bond Donor | 22 |
| Rotatable Bonds | 51 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.6900 | 69.00% |
| Caco-2 | - | 0.8636 | 86.36% |
| Blood Brain Barrier | - | 0.5000 | 50.00% |
| Human oral bioavailability | - | 0.6857 | 68.57% |
| Subcellular localzation | Mitochondria | 0.6603 | 66.03% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8219 | 82.19% |
| OATP1B3 inhibitior | + | 0.9126 | 91.26% |
| MATE1 inhibitior | - | 0.9800 | 98.00% |
| OCT2 inhibitior | - | 0.6067 | 60.67% |
| BSEP inhibitior | + | 0.8877 | 88.77% |
| P-glycoprotein inhibitior | + | 0.7340 | 73.40% |
| P-glycoprotein substrate | + | 0.7688 | 76.88% |
| CYP3A4 substrate | + | 0.7309 | 73.09% |
| CYP2C9 substrate | - | 1.0000 | 100.00% |
| CYP2D6 substrate | - | 0.8122 | 81.22% |
| CYP3A4 inhibition | - | 0.6971 | 69.71% |
| CYP2C9 inhibition | - | 0.8783 | 87.83% |
| CYP2C19 inhibition | - | 0.7692 | 76.92% |
| CYP2D6 inhibition | - | 0.8981 | 89.81% |
| CYP1A2 inhibition | - | 0.8335 | 83.35% |
| CYP2C8 inhibition | + | 0.7590 | 75.90% |
| CYP inhibitory promiscuity | - | 0.9528 | 95.28% |
| UGT catelyzed | - | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.8800 | 88.00% |
| Carcinogenicity (trinary) | Non-required | 0.7167 | 71.67% |
| Eye corrosion | - | 0.9857 | 98.57% |
| Eye irritation | - | 0.9001 | 90.01% |
| Skin irritation | - | 0.6833 | 68.33% |
| Skin corrosion | - | 0.9404 | 94.04% |
| Ames mutagenesis | + | 0.5322 | 53.22% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7783 | 77.83% |
| Micronuclear | - | 0.9000 | 90.00% |
| Hepatotoxicity | - | 0.5125 | 51.25% |
| skin sensitisation | - | 0.8409 | 84.09% |
| Respiratory toxicity | + | 0.6111 | 61.11% |
| Reproductive toxicity | + | 0.6444 | 64.44% |
| Mitochondrial toxicity | - | 0.5000 | 50.00% |
| Nephrotoxicity | - | 0.5803 | 58.03% |
| Acute Oral Toxicity (c) | III | 0.6422 | 64.22% |
| Estrogen receptor binding | + | 0.8157 | 81.57% |
| Androgen receptor binding | + | 0.6596 | 65.96% |
| Thyroid receptor binding | + | 0.5770 | 57.70% |
| Glucocorticoid receptor binding | + | 0.7108 | 71.08% |
| Aromatase binding | + | 0.5789 | 57.89% |
| PPAR gamma | + | 0.7868 | 78.68% |
| Honey bee toxicity | - | 0.6555 | 65.55% |
| Biodegradation | - | 0.6500 | 65.00% |
| Crustacea aquatic toxicity | - | 0.7500 | 75.00% |
| Fish aquatic toxicity | + | 0.9283 | 92.83% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.36% | 83.82% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.66% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.50% | 96.09% |
| CHEMBL2730 | P21980 | Protein-glutamine gamma-glutamyltransferase | 93.81% | 92.38% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.76% | 98.95% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 93.31% | 97.29% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 92.29% | 96.47% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.23% | 90.17% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.97% | 93.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.83% | 94.73% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 91.70% | 94.45% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 90.50% | 98.75% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.76% | 99.17% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 89.71% | 100.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.95% | 95.89% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 88.52% | 87.45% |
| CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 87.81% | 87.16% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 87.32% | 89.34% |
| CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 86.67% | 94.55% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.40% | 97.25% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 86.39% | 97.64% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 86.32% | 92.88% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 85.62% | 92.32% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 85.06% | 91.24% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 84.98% | 97.47% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.86% | 95.89% |
| CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 84.73% | 82.50% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 84.71% | 93.10% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 84.37% | 95.71% |
| CHEMBL4361 | Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | 84.15% | 95.52% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.14% | 90.71% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.05% | 97.09% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.95% | 100.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.86% | 96.00% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 83.53% | 92.86% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.34% | 90.08% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 82.51% | 97.79% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 81.74% | 85.94% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 81.22% | 100.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 81.14% | 91.49% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 81.13% | 96.03% |
| CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 81.11% | 85.83% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 81.10% | 98.05% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 80.81% | 95.00% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 80.47% | 95.58% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.29% | 97.36% |
| CHEMBL3572 | P11597 | Cholesteryl ester transfer protein | 80.02% | 92.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 46919394 |
| LOTUS | LTS0257132 |
| wikiData | Q105246894 |