2-[2-(Hydroxymethyl)-6-(1'-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl)oxy-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | 35ef9fcf-159f-4b3c-a1fd-54dc26fef7c8 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 2-[2-(hydroxymethyl)-6-(1'-hydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl)oxy-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-4-(3,4,5-trihydroxyoxan-2-yl)oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC=C6C5(CCC(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)C)O)O)O)OC9C(C(C(CO9)O)O)O)OC2C(C(C(C(O2)C)O)O)O)C)C)C)N(C1)O |
SMILES (Isomeric) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC=C6C5(CCC(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)C)O)O)O)OC9C(C(C(CO9)O)O)O)OC2C(C(C(C(O2)C)O)O)O)C)C)C)N(C1)O |
InChI | InChI=1S/C50H81NO20/c1-20-9-14-50(51(62)17-20)21(2)32-30(71-50)16-28-26-8-7-24-15-25(10-12-48(24,5)27(26)11-13-49(28,32)6)66-47-43(70-46-40(61)37(58)34(55)23(4)65-46)42(69-44-38(59)35(56)29(53)19-63-44)41(31(18-52)67-47)68-45-39(60)36(57)33(54)22(3)64-45/h7,20-23,25-47,52-62H,8-19H2,1-6H3 |
InChI Key | HNMOCCUDUXOCOP-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C50H81NO20 |
Molecular Weight | 1016.20 g/mol |
Exact Mass | 1015.53519397 g/mol |
Topological Polar Surface Area (TPSA) | 309.00 Ų |
XlogP | -0.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.11% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.59% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 97.48% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.24% | 97.09% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 94.77% | 89.05% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.00% | 86.33% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 91.97% | 97.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.75% | 100.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.54% | 89.00% |
CHEMBL233 | P35372 | Mu opioid receptor | 90.30% | 97.93% |
CHEMBL2581 | P07339 | Cathepsin D | 89.37% | 98.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.66% | 95.89% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.53% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.20% | 95.89% |
CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 86.98% | 94.50% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 84.94% | 96.61% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.60% | 94.00% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 84.00% | 98.46% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.93% | 92.94% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.69% | 95.50% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 82.69% | 95.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.33% | 100.00% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.25% | 100.00% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 81.33% | 97.50% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.20% | 92.50% |
CHEMBL5028 | O14672 | ADAM10 | 80.61% | 97.50% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.39% | 97.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum robustum |
PubChem | 163091875 |
LOTUS | LTS0147771 |
wikiData | Q105030945 |