4,4-dichloro-N-[5,5-dichloro-1-oxo-1-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]pentan-2-yl]-3-methylbutanamide
| Internal ID | bd4a1bf5-54f2-4129-9249-c7db668aceee |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > N-acyl-alpha amino acids and derivatives |
| IUPAC Name | 4,4-dichloro-N-[5,5-dichloro-1-oxo-1-[2-(1,3-thiazol-2-yl)pyrrolidin-1-yl]pentan-2-yl]-3-methylbutanamide |
| SMILES (Canonical) | CC(CC(=O)NC(CCC(Cl)Cl)C(=O)N1CCCC1C2=NC=CS2)C(Cl)Cl |
| SMILES (Isomeric) | CC(CC(=O)NC(CCC(Cl)Cl)C(=O)N1CCCC1C2=NC=CS2)C(Cl)Cl |
| InChI | InChI=1S/C17H23Cl4N3O2S/c1-10(15(20)21)9-14(25)23-11(4-5-13(18)19)17(26)24-7-2-3-12(24)16-22-6-8-27-16/h6,8,10-13,15H,2-5,7,9H2,1H3,(H,23,25) |
| InChI Key | RPRWFPARDQEVRJ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H23Cl4N3O2S |
| Molecular Weight | 475.30 g/mol |
| Exact Mass | 475.023559 g/mol |
| Topological Polar Surface Area (TPSA) | 90.50 Ų |
| XlogP | 4.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.27% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.68% | 98.95% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 96.44% | 98.33% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 94.23% | 90.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.93% | 94.45% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 88.29% | 96.90% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 86.63% | 98.05% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 85.93% | 99.18% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 85.44% | 98.24% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.81% | 91.11% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 84.66% | 89.34% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 84.36% | 90.24% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.40% | 99.17% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 82.98% | 100.00% |
| CHEMBL3691 | Q13822 | Autotaxin | 81.98% | 96.39% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.98% | 98.75% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 81.54% | 93.10% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.89% | 90.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.11% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 101131156 |
| LOTUS | LTS0078015 |
| wikiData | Q105242993 |