[(4R,5S,6R,7R,9S,19E,21S,24R,25S,26R,27R,44R,45R)-6,25,26-triacetyloxy-45-hydroxy-40,43-dimethoxy-9,21,45-trimethyl-2,12,22,30-tetraoxo-3,8,11,23,29,38-hexaoxa-17,33-diazaoctacyclo[37.2.2.14,27.17,24.05,9.07,27.013,18.031,36]pentatetraconta-1(41),13(18),14,16,19,31(36),32,34,39,42-decaen-44-yl] 2-acetyloxy-2-methylpropanoate
Internal ID | 84f5e032-c024-4e44-bf45-83a374f0d324 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | [(4R,5S,6R,7R,9S,19E,21S,24R,25S,26R,27R,44R,45R)-6,25,26-triacetyloxy-45-hydroxy-40,43-dimethoxy-9,21,45-trimethyl-2,12,22,30-tetraoxo-3,8,11,23,29,38-hexaoxa-17,33-diazaoctacyclo[37.2.2.14,27.17,24.05,9.07,27.013,18.031,36]pentatetraconta-1(41),13(18),14,16,19,31(36),32,34,39,42-decaen-44-yl] 2-acetyloxy-2-methylpropanoate |
SMILES (Canonical) | CC1C=CC2=C(C=CC=N2)C(=O)OCC3(C4C5C(C6(COC(=O)C7=C(COC8=C(C=C(C=C8OC)C(=O)O5)OC)C=CN=C7)C(C(C(C(C6(C4OC(=O)C)O3)(C)O)OC1=O)OC(=O)C)OC(=O)C)OC(=O)C(C)(C)OC(=O)C)C |
SMILES (Isomeric) | C[C@H]1/C=C/C2=C(C=CC=N2)C(=O)OC[C@@]3([C@H]4[C@@H]5[C@@H]([C@]6(COC(=O)C7=C(COC8=C(C=C(C=C8OC)C(=O)O5)OC)C=CN=C7)[C@H]([C@@H]([C@H]([C@@]([C@@]6([C@@H]4OC(=O)C)O3)(C)O)OC1=O)OC(=O)C)OC(=O)C)OC(=O)C(C)(C)OC(=O)C)C |
InChI | InChI=1S/C54H58N2O23/c1-25-14-15-34-32(13-12-17-56-34)47(63)70-23-51(8)37-39-43(77-49(65)50(6,7)78-29(5)60)53(24-71-48(64)33-21-55-18-16-30(33)22-69-38-35(67-10)19-31(46(62)75-39)20-36(38)68-11)44(74-28(4)59)40(72-26(2)57)42(76-45(25)61)52(9,66)54(53,79-51)41(37)73-27(3)58/h12-21,25,37,39-44,66H,22-24H2,1-11H3/b15-14+/t25-,37-,39+,40+,41+,42+,43-,44-,51+,52+,53+,54+/m0/s1 |
InChI Key | UPRBGLBIQADMJX-PBJOBLCLSA-N |
Popularity | 0 references in papers |
Molecular Formula | C54H58N2O23 |
Molecular Weight | 1103.00 g/mol |
Exact Mass | 1102.34303610 g/mol |
Topological Polar Surface Area (TPSA) | 320.00 Ų |
XlogP | 2.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 99.82% | 85.14% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.46% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 98.59% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.34% | 96.09% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 98.28% | 96.00% |
CHEMBL2581 | P07339 | Cathepsin D | 98.14% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.27% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.91% | 94.00% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.84% | 97.25% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.77% | 89.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 91.75% | 82.69% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 91.05% | 95.89% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 90.62% | 97.53% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 90.57% | 92.94% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.50% | 100.00% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 89.57% | 91.24% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 89.50% | 95.89% |
CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 89.49% | 95.78% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.14% | 95.56% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 88.13% | 97.14% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 87.78% | 97.33% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.74% | 99.23% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.51% | 99.17% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 86.06% | 95.71% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.74% | 91.07% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 85.27% | 96.67% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 85.26% | 94.42% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 84.68% | 100.00% |
CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 84.21% | 92.38% |
CHEMBL2535 | P11166 | Glucose transporter | 84.18% | 98.75% |
CHEMBL5896 | O75164 | Lysine-specific demethylase 4A | 84.03% | 99.09% |
CHEMBL5747 | Q92793 | CREB-binding protein | 83.83% | 95.12% |
CHEMBL5028 | O14672 | ADAM10 | 83.67% | 97.50% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 82.78% | 97.05% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 81.89% | 96.39% |
CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 81.64% | 96.09% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.56% | 92.62% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.74% | 96.00% |
CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 80.72% | 98.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Catha edulis |
PubChem | 163058279 |
LOTUS | LTS0017295 |
wikiData | Q105276953 |