(8-chloro-5-hydroxy-6,9-dimethyl-3-methylidene-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl) 2-(acetyloxymethyl)but-2-enoate
| Internal ID | 96072c45-eae4-453c-b446-8c72008e7033 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Tricarboxylic acids and derivatives |
| IUPAC Name | (8-chloro-5-hydroxy-6,9-dimethyl-3-methylidene-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl) 2-(acetyloxymethyl)but-2-enoate |
| SMILES (Canonical) | CC=C(COC(=O)C)C(=O)OC1C2C(C3C(=C(C(=O)C3=C(C1O)C)Cl)C)OC(=O)C2=C |
| SMILES (Isomeric) | CC=C(COC(=O)C)C(=O)OC1C2C(C3C(=C(C(=O)C3=C(C1O)C)Cl)C)OC(=O)C2=C |
| InChI | InChI=1S/C22H23ClO8/c1-6-12(7-29-11(5)24)22(28)31-20-15-10(4)21(27)30-19(15)14-8(2)16(23)18(26)13(14)9(3)17(20)25/h6,14-15,17,19-20,25H,4,7H2,1-3,5H3 |
| InChI Key | VTHACUIBICUQIO-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C22H23ClO8 |
| Molecular Weight | 450.90 g/mol |
| Exact Mass | 450.1081454 g/mol |
| Topological Polar Surface Area (TPSA) | 116.00 Ų |
| XlogP | 1.40 |
| There are no found synonyms. |
![2D Structure of (8-chloro-5-hydroxy-6,9-dimethyl-3-methylidene-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl) 2-(acetyloxymethyl)but-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/79aa7df0-83a3-11ee-a98b-1f6946ea2e0d.jpg "2D Structure of (8-chloro-5-hydroxy-6,9-dimethyl-3-methylidene-2,7-dioxo-4,5,9a,9b-tetrahydro-3aH-azuleno[4,5-b]furan-4-yl) 2-(acetyloxymethyl)but-2-enoate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.60% | 94.45% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 92.11% | 89.34% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.24% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.78% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 88.82% | 91.49% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.96% | 86.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.31% | 91.11% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 86.76% | 98.75% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.68% | 97.25% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.09% | 95.56% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.42% | 94.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.31% | 96.90% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 82.03% | 91.19% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.07% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lasiolaena morii |
| Lasiolaena santosii |
| PubChem | 162981310 |
| LOTUS | LTS0214854 |
| wikiData | Q105292730 |