[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-(3,4,5-trihydroxybenzoyl)oxy-tetrahydropyran-3-yl] 3,4,5-trihydroxybenzoate
Internal ID | a6f1f44b-50c1-4e74-b473-b27a512e8835 |
Taxonomy | Phenylpropanoids and polyketides > Tannins |
IUPAC Name | [(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-(3,4,5-trihydroxybenzoyl)oxyoxan-3-yl] 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1=C(C=C(C(=C1O)O)O)C(=O)OC2C(C(C(OC2OC(=O)C3=CC(=C(C(=C3)O)O)O)CO)O)O |
SMILES (Isomeric) | C1=C(C=C(C(=C1O)O)O)C(=O)O[C@@H]2[C@H]([C@@H]([C@H](O[C@H]2OC(=O)C3=CC(=C(C(=C3)O)O)O)CO)O)O |
InChI | InChI=1S/C20H20O14/c21-5-12-15(28)16(29)17(33-18(30)6-1-8(22)13(26)9(23)2-6)20(32-12)34-19(31)7-3-10(24)14(27)11(25)4-7/h1-4,12,15-17,20-29H,5H2/t12-,15-,16+,17-,20+/m1/s1 |
InChI Key | FNEQBVHIJSMWKC-IVABAYMNSA-N |
Popularity | 2 references in papers |
Molecular Formula | C20H20O14 |
Molecular Weight | 484.40 g/mol |
Exact Mass | 484.08530531 g/mol |
Topological Polar Surface Area (TPSA) | 244.00 Ų |
XlogP | -0.30 |
SCHEMBL5664342 |
DTXSID201220603 |
[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-(3,4,5-trihydroxybenzoyl)oxy-tetrahydropyran-3-yl] 3,4,5-trihydroxybenzoate |
115713-50-3 |
beta-D-Glucopyranose, 1,2-bis(3,4,5-trihydroxybenzoate) |
1,2-Bis-O-(3,4,5-trihydroxybenzoyl)-.beta.-D-glucopyranose |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.09% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.84% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 91.76% | 90.71% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.65% | 96.09% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 91.06% | 95.64% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.10% | 94.73% |
CHEMBL2581 | P07339 | Cathepsin D | 86.95% | 98.95% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 86.70% | 86.92% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 86.70% | 83.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.08% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.44% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.99% | 94.00% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 83.47% | 89.34% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.96% | 92.50% |
CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 81.88% | 97.53% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.27% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cornus officinalis |
PubChem | 475261 |
LOTUS | LTS0090642 |
wikiData | Q104998256 |