8,9a-Dihydroxy-6-methoxy-3a-(4-methoxyphenyl)-3-[2-(2,4,5-trimethoxyphenyl)ethenyl]-2,3-dihydrofuro[3,2-b]chromen-9-one
Internal ID | ac46593c-350f-45ad-a434-b8857eb381c2 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 7-O-methylated flavonoids |
IUPAC Name | 8,9a-dihydroxy-6-methoxy-3a-(4-methoxyphenyl)-3-[2-(2,4,5-trimethoxyphenyl)ethenyl]-2,3-dihydrofuro[3,2-b]chromen-9-one |
SMILES (Canonical) | COC1=CC=C(C=C1)C23C(COC2(C(=O)C4=C(C=C(C=C4O3)OC)O)O)C=CC5=CC(=C(C=C5OC)OC)OC |
SMILES (Isomeric) | COC1=CC=C(C=C1)C23C(COC2(C(=O)C4=C(C=C(C=C4O3)OC)O)O)C=CC5=CC(=C(C=C5OC)OC)OC |
InChI | InChI=1S/C30H30O10/c1-34-20-10-8-18(9-11-20)29-19(7-6-17-12-24(37-4)25(38-5)15-23(17)36-3)16-39-30(29,33)28(32)27-22(31)13-21(35-2)14-26(27)40-29/h6-15,19,31,33H,16H2,1-5H3 |
InChI Key | XGWDQUCPQMERCP-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H30O10 |
Molecular Weight | 550.60 g/mol |
Exact Mass | 550.18389715 g/mol |
Topological Polar Surface Area (TPSA) | 122.00 Ų |
XlogP | 4.20 |
There are no found synonyms. |
![2D Structure of 8,9a-Dihydroxy-6-methoxy-3a-(4-methoxyphenyl)-3-[2-(2,4,5-trimethoxyphenyl)ethenyl]-2,3-dihydrofuro[3,2-b]chromen-9-one 2D Structure of 8,9a-Dihydroxy-6-methoxy-3a-(4-methoxyphenyl)-3-[2-(2,4,5-trimethoxyphenyl)ethenyl]-2,3-dihydrofuro[3,2-b]chromen-9-one](https://plantaedb.com/storage/docs/compounds/2023/11/79834740-84a4-11ee-8ed5-db978055635b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.65% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.55% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 94.47% | 90.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.98% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.57% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.32% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.81% | 86.33% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.63% | 92.94% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.50% | 99.15% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.39% | 94.45% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 89.77% | 93.99% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.61% | 94.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 89.60% | 92.62% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.21% | 96.00% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 88.39% | 91.07% |
CHEMBL2581 | P07339 | Cathepsin D | 88.20% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.88% | 97.09% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.72% | 91.19% |
CHEMBL5925 | P22413 | Ectonucleotide pyrophosphatase/phosphodiesterase family member 1 | 84.61% | 92.38% |
CHEMBL2535 | P11166 | Glucose transporter | 84.44% | 98.75% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.78% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.78% | 99.23% |
CHEMBL240 | Q12809 | HERG | 80.32% | 89.76% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Alpinia flabellata |
PubChem | 85311142 |
LOTUS | LTS0066093 |
wikiData | Q105327877 |