2-[[(1S,4aS,5R,6R,8aS)-6-bromo-5-[(3R)-4-bromo-3-chloro-4-methylpentyl]-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]-4,6-dibromophenol
| Internal ID | b07014bb-5c60-4ae7-b499-607bef215174 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | 2-[[(1S,4aS,5R,6R,8aS)-6-bromo-5-[(3R)-4-bromo-3-chloro-4-methylpentyl]-5,8a-dimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]methyl]-4,6-dibromophenol |
| SMILES (Canonical) | CC12CCC(C(C1CCC(=C)C2CC3=C(C(=CC(=C3)Br)Br)O)(C)CCC(C(C)(C)Br)Cl)Br |
| SMILES (Isomeric) | C[C@@]12CC[C@H]([C@]([C@H]1CCC(=C)[C@@H]2CC3=C(C(=CC(=C3)Br)Br)O)(C)CC[C@H](C(C)(C)Br)Cl)Br |
| InChI | InChI=1S/C26H35Br4ClO/c1-15-6-7-20-25(4,18(15)13-16-12-17(27)14-19(28)23(16)32)10-8-21(29)26(20,5)11-9-22(31)24(2,3)30/h12,14,18,20-22,32H,1,6-11,13H2,2-5H3/t18-,20-,21+,22+,25-,26+/m0/s1 |
| InChI Key | NFMVWIXBGOEENC-HJBFPXMXSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H35Br4ClO |
| Molecular Weight | 718.60 g/mol |
| Exact Mass | 717.90689 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 9.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.03% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.82% | 97.25% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 94.04% | 82.69% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.83% | 98.95% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.42% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.94% | 95.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.65% | 90.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.57% | 94.45% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.11% | 89.62% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 85.80% | 98.75% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 85.34% | 90.24% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 85.22% | 95.34% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.20% | 100.00% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.16% | 92.62% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 85.10% | 89.34% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 84.78% | 95.17% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 83.79% | 90.93% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.76% | 89.00% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.71% | 100.00% |
| CHEMBL1871 | P10275 | Androgen Receptor | 82.82% | 96.43% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.28% | 91.07% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 82.23% | 93.18% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.19% | 97.09% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 81.63% | 85.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.26% | 100.00% |
| CHEMBL233 | P35372 | Mu opioid receptor | 80.69% | 97.93% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 80.66% | 96.90% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.42% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163191126 |
| LOTUS | LTS0076815 |
| wikiData | Q105178555 |