10-[5-(5,7-Dihydroxy-4-oxochromen-2-yl)-2-hydroxyphenyl]-5-hydroxy-8-(4-hydroxyphenyl)-2,2-dimethylpyrano[3,2-g]chromen-6-one
| Internal ID | f9024ad1-dc5f-48b8-8105-2fae4131943d |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Biflavonoids and polyflavonoids |
| IUPAC Name | 10-[5-(5,7-dihydroxy-4-oxochromen-2-yl)-2-hydroxyphenyl]-5-hydroxy-8-(4-hydroxyphenyl)-2,2-dimethylpyrano[3,2-g]chromen-6-one |
| SMILES (Canonical) | CC1(C=CC2=C(C3=C(C(=C2O1)C4=C(C=CC(=C4)C5=CC(=O)C6=C(C=C(C=C6O5)O)O)O)OC(=CC3=O)C7=CC=C(C=C7)O)O)C |
| SMILES (Isomeric) | CC1(C=CC2=C(C3=C(C(=C2O1)C4=C(C=CC(=C4)C5=CC(=O)C6=C(C=C(C=C6O5)O)O)O)OC(=CC3=O)C7=CC=C(C=C7)O)O)C |
| InChI | InChI=1S/C35H24O10/c1-35(2)10-9-20-32(42)31-25(41)15-26(16-3-6-18(36)7-4-16)44-34(31)29(33(20)45-35)21-11-17(5-8-22(21)38)27-14-24(40)30-23(39)12-19(37)13-28(30)43-27/h3-15,36-39,42H,1-2H3 |
| InChI Key | UKUSZBXLMJFGPN-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C35H24O10 |
| Molecular Weight | 604.60 g/mol |
| Exact Mass | 604.13694696 g/mol |
| Topological Polar Surface Area (TPSA) | 163.00 Ų |
| XlogP | 6.30 |
| There are no found synonyms. |
![2D Structure of 10-[5-(5,7-Dihydroxy-4-oxochromen-2-yl)-2-hydroxyphenyl]-5-hydroxy-8-(4-hydroxyphenyl)-2,2-dimethylpyrano[3,2-g]chromen-6-one](https://plantaedb.com/storage/docs/compounds/2023/11/796e39d0-8429-11ee-8a77-d1f4215e1ee1.jpg "2D Structure of 10-[5-(5,7-Dihydroxy-4-oxochromen-2-yl)-2-hydroxyphenyl]-5-hydroxy-8-(4-hydroxyphenyl)-2,2-dimethylpyrano[3,2-g]chromen-6-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.60% | 91.11% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 99.22% | 98.35% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.17% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.90% | 89.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.73% | 91.49% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 96.64% | 99.15% |
| CHEMBL3194 | P02766 | Transthyretin | 94.92% | 90.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.82% | 94.45% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.26% | 94.00% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 90.35% | 85.11% |
| CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 89.86% | 89.23% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.11% | 90.71% |
| CHEMBL301 | P24941 | Cyclin-dependent kinase 2 | 89.09% | 91.23% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 88.02% | 91.38% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.21% | 94.73% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.65% | 90.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.42% | 99.23% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.33% | 86.33% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 85.27% | 91.71% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 85.04% | 93.10% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.72% | 96.21% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.58% | 95.56% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 83.30% | 95.71% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 81.62% | 95.64% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 81.53% | 97.28% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 81.48% | 95.78% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 81.23% | 94.42% |
| CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 80.86% | 91.76% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Calophyllum inophyllum |
| Calophyllum venulosum |
| PubChem | 21582613 |
| LOTUS | LTS0203767 |
| wikiData | Q105274918 |