8-methoxy-3a,5a,7a,8,11b,13a-hexamethyl-3-propan-2-yl-2,3,4,5,5b,6,7,9,10,11,11a,12,13,13b-tetradecahydro-1H-cyclopenta[a]chrysen-9-ol
Internal ID | f05c2dc0-4eee-4f18-9825-d0e23df3af72 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Colensane and clerodane diterpenoids |
IUPAC Name | 8-methoxy-3a,5a,7a,8,11b,13a-hexamethyl-3-propan-2-yl-2,3,4,5,5b,6,7,9,10,11,11a,12,13,13b-tetradecahydro-1H-cyclopenta[a]chrysen-9-ol |
SMILES (Canonical) | CC(C)C1CCC2C1(CCC3(C2(CCC4(C3CCC5(C4CCC(C5(C)OC)O)C)C)C)C)C |
SMILES (Isomeric) | CC(C)C1CCC2C1(CCC3(C2(CCC4(C3CCC5(C4CCC(C5(C)OC)O)C)C)C)C)C |
InChI | InChI=1S/C31H54O2/c1-20(2)21-10-11-22-26(21,3)16-18-29(6)24-14-15-30(7)23(12-13-25(32)31(30,8)33-9)27(24,4)17-19-28(22,29)5/h20-25,32H,10-19H2,1-9H3 |
InChI Key | BAZGULPPAVJJRU-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C31H54O2 |
Molecular Weight | 458.80 g/mol |
Exact Mass | 458.412380961 g/mol |
Topological Polar Surface Area (TPSA) | 29.50 Ų |
XlogP | 9.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 96.04% | 96.38% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.66% | 96.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.65% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.45% | 94.45% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.57% | 95.89% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 89.37% | 92.86% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.55% | 82.69% |
CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 86.69% | 87.16% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 86.22% | 91.03% |
CHEMBL2581 | P07339 | Cathepsin D | 86.09% | 98.95% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 85.84% | 85.31% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 85.76% | 92.88% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 85.13% | 99.18% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.44% | 94.75% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.84% | 100.00% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 82.61% | 92.98% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.55% | 97.09% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 81.74% | 97.14% |
CHEMBL1871 | P10275 | Androgen Receptor | 81.72% | 96.43% |
CHEMBL279 | P35968 | Vascular endothelial growth factor receptor 2 | 81.43% | 95.52% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 81.22% | 91.49% |
CHEMBL2959 | Q08881 | Tyrosine-protein kinase ITK/TSK | 81.16% | 95.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.03% | 100.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.19% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Adiantum caudatum |
PubChem | 163049036 |
LOTUS | LTS0073917 |
wikiData | Q104922564 |