(3S,5R,8R,9R,10R,14S,17R)-4,4,8,10,14-pentamethyl-17-[(Z)-6-methylhept-2-en-2-yl]-2,3,5,6,7,9,11,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol
Internal ID | d2fc86cf-34b5-4672-93a6-75c26963f043 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (3S,5R,8R,9R,10R,14S,17R)-4,4,8,10,14-pentamethyl-17-[(Z)-6-methylhept-2-en-2-yl]-2,3,5,6,7,9,11,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
SMILES (Canonical) | CC(C)CCC=C(C)C1CCC2(C1=CCC3C2(CCC4C3(CCC(C4(C)C)O)C)C)C |
SMILES (Isomeric) | CC(C)CC/C=C(/C)\[C@H]1CC[C@@]2(C1=CC[C@H]3[C@]2(CC[C@@H]4[C@@]3(CC[C@@H](C4(C)C)O)C)C)C |
InChI | InChI=1S/C30H50O/c1-20(2)10-9-11-21(3)22-14-18-29(7)23(22)12-13-25-28(6)17-16-26(31)27(4,5)24(28)15-19-30(25,29)8/h11-12,20,22,24-26,31H,9-10,13-19H2,1-8H3/b21-11-/t22-,24+,25-,26+,28+,29-,30-/m1/s1 |
InChI Key | CGLQOXNFBZNJSB-XGPOGTDQSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H50O |
Molecular Weight | 426.70 g/mol |
Exact Mass | 426.386166214 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 9.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.42% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.44% | 96.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.90% | 94.75% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.71% | 90.17% |
CHEMBL2581 | P07339 | Cathepsin D | 91.63% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.23% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.77% | 97.25% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 88.38% | 95.93% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.02% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.87% | 97.09% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.24% | 82.69% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.18% | 93.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.11% | 95.89% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 83.37% | 100.00% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 82.97% | 93.00% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 82.87% | 85.30% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.36% | 90.08% |
CHEMBL3837 | P07711 | Cathepsin L | 80.92% | 96.61% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Plumeria obtusa |
PubChem | 162899658 |
LOTUS | LTS0064312 |
wikiData | Q104957839 |