2-[3-Hydroxy-4-[[4-hydroxy-2-methyl-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl]-5-methylphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
| Internal ID | c49ffa3b-0503-471e-80a2-89333e971dd6 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
| IUPAC Name | 2-[3-hydroxy-4-[[4-hydroxy-2-methyl-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl]-5-methylphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES (Canonical) | CC1=CC(=CC(=C1CC2=C(C=C(C=C2C)OC3C(C(C(C(O3)CO)O)O)O)O)OC4C(C(C(C(O4)CO)O)O)O)O |
| SMILES (Isomeric) | CC1=CC(=CC(=C1CC2=C(C=C(C=C2C)OC3C(C(C(C(O3)CO)O)O)O)O)OC4C(C(C(C(O4)CO)O)O)O)O |
| InChI | InChI=1S/C27H36O14/c1-10-3-12(30)5-17(39-27-25(37)23(35)21(33)19(9-29)41-27)15(10)7-14-11(2)4-13(6-16(14)31)38-26-24(36)22(34)20(32)18(8-28)40-26/h3-6,18-37H,7-9H2,1-2H3 |
| InChI Key | SSRDNYPQPSWDOS-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C27H36O14 |
| Molecular Weight | 584.60 g/mol |
| Exact Mass | 584.21050582 g/mol |
| Topological Polar Surface Area (TPSA) | 239.00 Ų |
| XlogP | -0.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.21% | 91.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.53% | 94.73% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 90.78% | 99.15% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.65% | 94.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.30% | 99.17% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.78% | 89.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.66% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 86.05% | 98.95% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 85.99% | 97.36% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.70% | 86.92% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 84.27% | 83.57% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.14% | 90.00% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.04% | 96.95% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 83.64% | 94.80% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 82.42% | 93.18% |
| CHEMBL5339 | Q5NUL3 | G-protein coupled receptor 120 | 81.40% | 95.78% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.84% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.09% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Curculigo orchioides |
| PubChem | 163029763 |
| LOTUS | LTS0163904 |
| wikiData | Q105259844 |