2-amino-4-[[1-[[6-(2-amino-2-oxoethyl)-3-[2-[1-hydroxy-3-oxo-3-[(11,19,27,35-tetraamino-3-hydroxyhexatriacontyl)amino]propyl]pyrrolidine-1-carbonyl]-2-methyl-5,8,11-trioxo-1,4,7-triazacycloundec-9-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]-4-oxobutanoic acid
| Internal ID | 6bd58837-e6fc-43f4-b9cc-390ea30c0a27 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Cyclic peptides |
| IUPAC Name | 2-amino-4-[[1-[[6-(2-amino-2-oxoethyl)-3-[2-[1-hydroxy-3-oxo-3-[(11,19,27,35-tetraamino-3-hydroxyhexatriacontyl)amino]propyl]pyrrolidine-1-carbonyl]-2-methyl-5,8,11-trioxo-1,4,7-triazacycloundec-9-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]amino]-4-oxobutanoic acid |
| SMILES (Canonical) | CC1C(NC(=O)C(NC(=O)C(CC(=O)N1)NC(=O)C(CC2=CN=CN2)NC(=O)CC(C(=O)O)N)CC(=O)N)C(=O)N3CCCC3C(CC(=O)NCCC(CCCCCCCC(CCCCCCCC(CCCCCCCC(CCCCCCCC(C)N)N)N)N)O)O |
| SMILES (Isomeric) | CC1C(NC(=O)C(NC(=O)C(CC(=O)N1)NC(=O)C(CC2=CN=CN2)NC(=O)CC(C(=O)O)N)CC(=O)N)C(=O)N3CCCC3C(CC(=O)NCCC(CCCCCCCC(CCCCCCCC(CCCCCCCC(CCCCCCCC(C)N)N)N)N)O)O |
| InChI | InChI=1S/C65H119N15O12/c1-43(66)24-15-7-3-8-16-25-45(67)26-17-9-4-10-18-27-46(68)28-19-11-5-12-20-29-47(69)30-21-13-6-14-22-31-49(81)33-34-73-57(84)40-55(82)54-32-23-35-80(54)64(90)60-44(2)75-59(86)39-53(62(88)77-52(38-56(71)83)63(89)79-60)78-61(87)51(36-48-41-72-42-74-48)76-58(85)37-50(70)65(91)92/h41-47,49-55,60,81-82H,3-40,66-70H2,1-2H3,(H2,71,83)(H,72,74)(H,73,84)(H,75,86)(H,76,85)(H,77,88)(H,78,87)(H,79,89)(H,91,92) |
| InChI Key | OEHVIVCEBYGFLN-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C65H119N15O12 |
| Molecular Weight | 1302.70 g/mol |
| Exact Mass | 1301.91626429 g/mol |
| Topological Polar Surface Area (TPSA) | 475.00 Ų |
| XlogP | 0.00 |
| Atomic LogP (AlogP) | 2.34 |
| H-Bond Acceptor | 17 |
| H-Bond Donor | 16 |
| Rotatable Bonds | 49 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.5946 | 59.46% |
| Caco-2 | - | 0.8588 | 85.88% |
| Blood Brain Barrier | - | 0.9500 | 95.00% |
| Human oral bioavailability | - | 0.7429 | 74.29% |
| Subcellular localzation | Lysosomes | 0.4533 | 45.33% |
| OATP2B1 inhibitior | - | 0.8596 | 85.96% |
| OATP1B1 inhibitior | + | 0.8119 | 81.19% |
| OATP1B3 inhibitior | + | 0.9261 | 92.61% |
| MATE1 inhibitior | - | 0.9009 | 90.09% |
| OCT2 inhibitior | - | 0.9250 | 92.50% |
| BSEP inhibitior | + | 0.8977 | 89.77% |
| P-glycoprotein inhibitior | + | 0.7410 | 74.10% |
| P-glycoprotein substrate | + | 0.8733 | 87.33% |
| CYP3A4 substrate | + | 0.7334 | 73.34% |
| CYP2C9 substrate | - | 0.8036 | 80.36% |
| CYP2D6 substrate | - | 0.8350 | 83.50% |
| CYP3A4 inhibition | - | 0.8893 | 88.93% |
| CYP2C9 inhibition | - | 0.8923 | 89.23% |
| CYP2C19 inhibition | - | 0.8424 | 84.24% |
| CYP2D6 inhibition | - | 0.9306 | 93.06% |
| CYP1A2 inhibition | - | 0.9335 | 93.35% |
| CYP2C8 inhibition | + | 0.7473 | 74.73% |
| CYP inhibitory promiscuity | - | 0.9241 | 92.41% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.8700 | 87.00% |
| Carcinogenicity (trinary) | Non-required | 0.6093 | 60.93% |
| Eye corrosion | - | 0.9887 | 98.87% |
| Eye irritation | - | 0.8975 | 89.75% |
| Skin irritation | - | 0.7752 | 77.52% |
| Skin corrosion | - | 0.9336 | 93.36% |
| Ames mutagenesis | - | 0.6000 | 60.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.6485 | 64.85% |
| Micronuclear | + | 0.8600 | 86.00% |
| Hepatotoxicity | - | 0.5965 | 59.65% |
| skin sensitisation | - | 0.8816 | 88.16% |
| Respiratory toxicity | + | 0.8000 | 80.00% |
| Reproductive toxicity | + | 0.9333 | 93.33% |
| Mitochondrial toxicity | + | 0.8750 | 87.50% |
| Nephrotoxicity | - | 0.6091 | 60.91% |
| Acute Oral Toxicity (c) | III | 0.6109 | 61.09% |
| Estrogen receptor binding | + | 0.7254 | 72.54% |
| Androgen receptor binding | + | 0.6761 | 67.61% |
| Thyroid receptor binding | + | 0.5937 | 59.37% |
| Glucocorticoid receptor binding | + | 0.5885 | 58.85% |
| Aromatase binding | + | 0.6918 | 69.18% |
| PPAR gamma | + | 0.7140 | 71.40% |
| Honey bee toxicity | - | 0.7038 | 70.38% |
| Biodegradation | - | 0.8750 | 87.50% |
| Crustacea aquatic toxicity | - | 0.5476 | 54.76% |
| Fish aquatic toxicity | - | 0.4415 | 44.15% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.78% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.67% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.85% | 83.82% |
| CHEMBL4801 | P29466 | Caspase-1 | 97.43% | 96.85% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 97.18% | 98.33% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 96.69% | 90.08% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 96.37% | 94.66% |
| CHEMBL236 | P41143 | Delta opioid receptor | 96.23% | 99.35% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.09% | 94.45% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 95.93% | 97.23% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 95.00% | 97.64% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 94.84% | 90.71% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 94.75% | 88.42% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 94.04% | 95.00% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 94.00% | 98.24% |
| CHEMBL4302 | P08183 | P-glycoprotein 1 | 93.65% | 92.98% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 93.36% | 96.47% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 93.02% | 95.56% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 92.65% | 92.29% |
| CHEMBL233 | P35372 | Mu opioid receptor | 92.22% | 97.93% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.80% | 97.09% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 91.73% | 96.90% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.70% | 91.11% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.61% | 93.56% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 91.28% | 100.00% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 90.09% | 96.25% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.08% | 99.17% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 89.79% | 96.76% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 89.40% | 90.20% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 89.32% | 96.31% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 89.15% | 93.03% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.48% | 99.23% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 87.98% | 95.62% |
| CHEMBL5028 | O14672 | ADAM10 | 87.36% | 97.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.80% | 95.89% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 85.55% | 96.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 85.38% | 85.14% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.15% | 100.00% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 84.61% | 96.11% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 84.35% | 93.10% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.34% | 95.50% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.56% | 89.00% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 83.53% | 98.94% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 83.44% | 88.56% |
| CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 82.92% | 90.24% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.60% | 95.56% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 82.51% | 98.05% |
| CHEMBL3784 | Q09472 | Histone acetyltransferase p300 | 82.11% | 93.33% |
| CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 81.69% | 94.55% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.60% | 97.25% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 81.44% | 96.21% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.53% | 93.00% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 80.50% | 82.86% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.06% | 89.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 145720650 |
| LOTUS | LTS0101361 |
| wikiData | Q104193292 |