7,9,13-Trimethyl-6-(3-methylbutyl)-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-14,16-diol
| Internal ID | 47da3da0-0b79-4438-af64-582dfdd3c3e9 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Furostanes and derivatives |
| IUPAC Name | 7,9,13-trimethyl-6-(3-methylbutyl)-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-14,16-diol |
| SMILES (Canonical) | CC1C(OC2C1C3(CCC4C(C3C2)CC=C5C4(C(CC(C5)O)O)C)C)CCC(C)C |
| SMILES (Isomeric) | CC1C(OC2C1C3(CCC4C(C3C2)CC=C5C4(C(CC(C5)O)O)C)C)CCC(C)C |
| InChI | InChI=1S/C27H44O3/c1-15(2)6-9-22-16(3)25-23(30-22)14-21-19-8-7-17-12-18(28)13-24(29)27(17,5)20(19)10-11-26(21,25)4/h7,15-16,18-25,28-29H,6,8-14H2,1-5H3 |
| InChI Key | YHRVCEOENVRMCE-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C27H44O3 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.32904526 g/mol |
| Topological Polar Surface Area (TPSA) | 49.70 Ų |
| XlogP | 5.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.75% | 96.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 97.10% | 95.93% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.81% | 91.11% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 93.48% | 100.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.15% | 97.09% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 91.84% | 95.89% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 90.15% | 90.71% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.33% | 98.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 88.14% | 90.17% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 87.94% | 97.79% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.92% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.87% | 86.33% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 86.14% | 95.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.00% | 97.25% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 85.65% | 89.05% |
| CHEMBL1871 | P10275 | Androgen Receptor | 84.30% | 96.43% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.09% | 89.00% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 83.95% | 98.05% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 83.90% | 86.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.65% | 93.56% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 82.23% | 98.46% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 82.01% | 96.61% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cordyline rubra |
| PubChem | 14585493 |
| LOTUS | LTS0092435 |
| wikiData | Q105348574 |