4,9,33-Trihydroxy-10-methoxy-1,8,13,29-tetramethyl-11,17,21,26,31-pentaoxadecacyclo[17.17.3.14,8.02,16.05,7.010,14.016,39.033,37.034,36.015,40]tetraconta-13,15(40),19(39),28-tetraene-12,18,22,25,30-pentone
Internal ID | 9c18a540-d1f8-4721-8bd7-5a9cb98c4f1b |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 4,9,33-trihydroxy-10-methoxy-1,8,13,29-tetramethyl-11,17,21,26,31-pentaoxadecacyclo[17.17.3.14,8.02,16.05,7.010,14.016,39.033,37.034,36.015,40]tetraconta-13,15(40),19(39),28-tetraene-12,18,22,25,30-pentone |
SMILES (Canonical) | CC1=CCOC(=O)CCC(=O)OCC2=C3CC4C(C5CC5C4(COC1=O)O)(C6C3(C7=C8C(C9CC9C8(C6)O)(C(C1(C7=C(C(=O)O1)C)OC)O)C)OC2=O)C |
SMILES (Isomeric) | CC1=CCOC(=O)CCC(=O)OCC2=C3CC4C(C5CC5C4(COC1=O)O)(C6C3(C7=C8C(C9CC9C8(C6)O)(C(C1(C7=C(C(=O)O1)C)OC)O)C)OC2=O)C |
InChI | InChI=1S/C40H44O14/c1-16-8-9-50-26(41)6-7-27(42)51-14-18-19-12-24-35(3,20-10-23(20)38(24,48)15-52-31(16)43)25-13-37(47)22-11-21(22)36(4)30(37)29(39(19,25)53-33(18)45)28-17(2)32(44)54-40(28,49-5)34(36)46/h8,20-25,34,46-48H,6-7,9-15H2,1-5H3 |
InChI Key | NASSYBOEZYWDCR-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C40H44O14 |
Molecular Weight | 748.80 g/mol |
Exact Mass | 748.27310607 g/mol |
Topological Polar Surface Area (TPSA) | 201.00 Ų |
XlogP | -0.90 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.01% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.26% | 95.56% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.96% | 85.14% |
CHEMBL2581 | P07339 | Cathepsin D | 92.99% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.24% | 99.23% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.58% | 97.09% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 90.45% | 97.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.27% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.80% | 100.00% |
CHEMBL1871 | P10275 | Androgen Receptor | 87.69% | 96.43% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.26% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.19% | 96.09% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 87.05% | 82.69% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.74% | 86.33% |
CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 85.66% | 82.38% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.72% | 97.25% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.23% | 94.73% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 81.37% | 97.05% |
CHEMBL5028 | O14672 | ADAM10 | 81.35% | 97.50% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.59% | 96.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Chloranthus tianmushanensis |
PubChem | 74342462 |
LOTUS | LTS0204472 |
wikiData | Q105176515 |