3,6,7-trihydroxy-5-methoxy-2-[4-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]chromen-4-one
Internal ID | ed05bb34-338e-410b-abbc-466d027b16b4 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides |
IUPAC Name | 3,6,7-trihydroxy-5-methoxy-2-[4-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]chromen-4-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2=CC=C(C=C2)C3=C(C(=O)C4=C(O3)C=C(C(=C4OC)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@@H]([C@@H](O1)OC2=CC=C(C=C2)C3=C(C(=O)C4=C(O3)C=C(C(=C4OC)O)O)O)O)O)O |
InChI | InChI=1S/C22H22O11/c1-8-14(24)17(27)19(29)22(31-8)32-10-5-3-9(4-6-10)20-18(28)16(26)13-12(33-20)7-11(23)15(25)21(13)30-2/h3-8,14,17,19,22-25,27-29H,1-2H3/t8-,14-,17+,19-,22-/m0/s1 |
InChI Key | COJAFCZHQKNUSI-MPZURVSHSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H22O11 |
Molecular Weight | 462.40 g/mol |
Exact Mass | 462.11621151 g/mol |
Topological Polar Surface Area (TPSA) | 175.00 Ų |
XlogP | 0.60 |
There are no found synonyms. |
![2D Structure of 3,6,7-trihydroxy-5-methoxy-2-[4-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]chromen-4-one 2D Structure of 3,6,7-trihydroxy-5-methoxy-2-[4-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyphenyl]chromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/78f310c0-86a6-11ee-bf5f-1b859fb4ad94.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.82% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 98.21% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.13% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.81% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 93.83% | 99.15% |
CHEMBL2581 | P07339 | Cathepsin D | 93.26% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 93.14% | 91.49% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.07% | 95.56% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 89.03% | 95.64% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.23% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.78% | 99.17% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 85.67% | 97.36% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.63% | 94.73% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 84.33% | 90.71% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 83.97% | 81.11% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.07% | 99.23% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.73% | 90.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.32% | 95.89% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 81.97% | 94.42% |
CHEMBL3194 | P02766 | Transthyretin | 80.48% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Polygonum recumbens |
PubChem | 163011365 |
LOTUS | LTS0081412 |
wikiData | Q104967063 |