[(1R,2S,3S,4R,5R,6R)-2,3,4,5-tetrahydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexyl] 16-methylheptadecanoate
Internal ID | 39b6982e-b386-47d4-9505-04da3d204396 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > O-glycosyl compounds |
IUPAC Name | [(1R,2S,3S,4R,5R,6R)-2,3,4,5-tetrahydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexyl] 16-methylheptadecanoate |
SMILES (Canonical) | CC(C)CCCCCCCCCCCCCCC(=O)OC1C(C(C(C(C1OC2C(C(C(C(O2)CO)O)O)O)O)O)O)O |
SMILES (Isomeric) | CC(C)CCCCCCCCCCCCCCC(=O)O[C@@H]1[C@H]([C@H]([C@H]([C@H]([C@H]1O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O)O)O)O |
InChI | InChI=1S/C30H56O12/c1-18(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-20(32)41-28-25(37)23(35)24(36)26(38)29(28)42-30-27(39)22(34)21(33)19(17-31)40-30/h18-19,21-31,33-39H,3-17H2,1-2H3/t19-,21-,22+,23+,24-,25+,26-,27-,28-,29-,30+/m1/s1 |
InChI Key | WLYICPDNPZKSFD-CKHDYPFJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H56O12 |
Molecular Weight | 608.80 g/mol |
Exact Mass | 608.37717722 g/mol |
Topological Polar Surface Area (TPSA) | 207.00 Ų |
XlogP | 3.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.36% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.72% | 99.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.32% | 91.11% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 93.29% | 92.50% |
CHEMBL2581 | P07339 | Cathepsin D | 92.42% | 98.95% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 91.77% | 96.47% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 89.14% | 97.29% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 88.64% | 93.56% |
CHEMBL237 | P41145 | Kappa opioid receptor | 88.20% | 98.10% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 87.23% | 85.94% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.09% | 94.73% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.96% | 96.00% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.67% | 94.33% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 84.28% | 91.24% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 82.93% | 82.50% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 82.90% | 83.82% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.71% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.28% | 94.45% |
CHEMBL1993 | P26358 | DNA (cytosine-5)-methyltransferase 1 | 82.10% | 95.44% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.95% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.93% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum lanceolatum |
PubChem | 163106432 |
LOTUS | LTS0088613 |
wikiData | Q105308342 |