(4aS,10R,10aS)-10-hydroxy-6-methoxy-1,1,4a-trimethyl-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one
Internal ID | 907e46b0-aec7-4505-9176-177df9e78371 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | (4aS,10R,10aS)-10-hydroxy-6-methoxy-1,1,4a-trimethyl-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one |
SMILES (Canonical) | CC(C)C1=C(C=C2C(=C1)C(=O)C(C3C2(CCCC3(C)C)C)O)OC |
SMILES (Isomeric) | CC(C)C1=C(C=C2C(=C1)C(=O)[C@@H]([C@@H]3[C@@]2(CCCC3(C)C)C)O)OC |
InChI | InChI=1S/C21H30O3/c1-12(2)13-10-14-15(11-16(13)24-6)21(5)9-7-8-20(3,4)19(21)18(23)17(14)22/h10-12,18-19,23H,7-9H2,1-6H3/t18-,19-,21+/m0/s1 |
InChI Key | BTFARGIVARHEON-IRFCIJBXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H30O3 |
Molecular Weight | 330.50 g/mol |
Exact Mass | 330.21949481 g/mol |
Topological Polar Surface Area (TPSA) | 46.50 Ų |
XlogP | 5.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.53% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.38% | 91.11% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 95.98% | 96.77% |
CHEMBL2581 | P07339 | Cathepsin D | 94.92% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.23% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 92.85% | 90.71% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.53% | 94.45% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 88.20% | 91.07% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.85% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.13% | 86.33% |
CHEMBL2535 | P11166 | Glucose transporter | 86.15% | 98.75% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.96% | 94.75% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.41% | 94.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 85.03% | 82.69% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.00% | 97.25% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.80% | 97.14% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.33% | 92.62% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.91% | 85.14% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.23% | 100.00% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.58% | 93.03% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.17% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cryptomeria japonica |
PubChem | 12114760 |
LOTUS | LTS0272650 |
wikiData | Q104945563 |